// Copyright 2021 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. package noder import ( "fmt" "go/constant" "internal/buildcfg" "internal/pkgbits" "strings" "cmd/compile/internal/base" "cmd/compile/internal/deadcode" "cmd/compile/internal/dwarfgen" "cmd/compile/internal/inline" "cmd/compile/internal/ir" "cmd/compile/internal/objw" "cmd/compile/internal/reflectdata" "cmd/compile/internal/staticinit" "cmd/compile/internal/typecheck" "cmd/compile/internal/types" "cmd/internal/obj" "cmd/internal/objabi" "cmd/internal/src" ) // This file implements cmd/compile backend's reader for the Unified // IR export data. // A pkgReader reads Unified IR export data. type pkgReader struct { pkgbits.PkgDecoder // Indices for encoded things; lazily populated as needed. // // Note: Objects (i.e., ir.Names) are lazily instantiated by // populating their types.Sym.Def; see objReader below. posBases []*src.PosBase pkgs []*types.Pkg typs []*types.Type // offset for rewriting the given (absolute!) index into the output, // but bitwise inverted so we can detect if we're missing the entry // or not. newindex []pkgbits.Index } func newPkgReader(pr pkgbits.PkgDecoder) *pkgReader { return &pkgReader{ PkgDecoder: pr, posBases: make([]*src.PosBase, pr.NumElems(pkgbits.RelocPosBase)), pkgs: make([]*types.Pkg, pr.NumElems(pkgbits.RelocPkg)), typs: make([]*types.Type, pr.NumElems(pkgbits.RelocType)), newindex: make([]pkgbits.Index, pr.TotalElems()), } } // A pkgReaderIndex compactly identifies an index (and its // corresponding dictionary) within a package's export data. type pkgReaderIndex struct { pr *pkgReader idx pkgbits.Index dict *readerDict methodSym *types.Sym synthetic func(pos src.XPos, r *reader) } func (pri pkgReaderIndex) asReader(k pkgbits.RelocKind, marker pkgbits.SyncMarker) *reader { if pri.synthetic != nil { return &reader{synthetic: pri.synthetic} } r := pri.pr.newReader(k, pri.idx, marker) r.dict = pri.dict r.methodSym = pri.methodSym return r } func (pr *pkgReader) newReader(k pkgbits.RelocKind, idx pkgbits.Index, marker pkgbits.SyncMarker) *reader { return &reader{ Decoder: pr.NewDecoder(k, idx, marker), p: pr, } } // A reader provides APIs for reading an individual element. type reader struct { pkgbits.Decoder p *pkgReader dict *readerDict // TODO(mdempsky): The state below is all specific to reading // function bodies. It probably makes sense to split it out // separately so that it doesn't take up space in every reader // instance. curfn *ir.Func locals []*ir.Name closureVars []*ir.Name funarghack bool // methodSym is the name of method's name, if reading a method. // It's nil if reading a normal function or closure body. methodSym *types.Sym // dictParam is the .dict param, if any. dictParam *ir.Name // synthetic is a callback function to construct a synthetic // function body. It's used for creating the bodies of function // literals used to curry arguments to shaped functions. synthetic func(pos src.XPos, r *reader) // scopeVars is a stack tracking the number of variables declared in // the current function at the moment each open scope was opened. scopeVars []int marker dwarfgen.ScopeMarker lastCloseScopePos src.XPos // === details for handling inline body expansion === // If we're reading in a function body because of inlining, this is // the call that we're inlining for. inlCaller *ir.Func inlCall *ir.CallExpr inlFunc *ir.Func inlTreeIndex int inlPosBases map[*src.PosBase]*src.PosBase // suppressInlPos tracks whether position base rewriting for // inlining should be suppressed. See funcLit. suppressInlPos int delayResults bool // Label to return to. retlabel *types.Sym // inlvars is the list of variables that the inlinee's arguments are // assigned to, one for each receiver and normal parameter, in order. inlvars ir.Nodes // retvars is the list of variables that the inlinee's results are // assigned to, one for each result parameter, in order. retvars ir.Nodes } // A readerDict represents an instantiated "compile-time dictionary," // used for resolving any derived types needed for instantiating a // generic object. // // A compile-time dictionary can either be "shaped" or "non-shaped." // Shaped compile-time dictionaries are only used for instantiating // shaped type definitions and function bodies, while non-shaped // compile-time dictionaries are used for instantiating runtime // dictionaries. type readerDict struct { shaped bool // whether this is a shaped dictionary // baseSym is the symbol for the object this dictionary belongs to. // If the object is an instantiated function or defined type, then // baseSym is the mangled symbol, including any type arguments. baseSym *types.Sym // For non-shaped dictionaries, shapedObj is a reference to the // corresponding shaped object (always a function or defined type). shapedObj *ir.Name // targs holds the implicit and explicit type arguments in use for // reading the current object. For example: // // func F[T any]() { // type X[U any] struct { t T; u U } // var _ X[string] // } // // var _ = F[int] // // While instantiating F[int], we need to in turn instantiate // X[string]. [int] and [string] are explicit type arguments for F // and X, respectively; but [int] is also the implicit type // arguments for X. // // (As an analogy to function literals, explicits are the function // literal's formal parameters, while implicits are variables // captured by the function literal.) targs []*types.Type // implicits counts how many of types within targs are implicit type // arguments; the rest are explicit. implicits int derived []derivedInfo // reloc index of the derived type's descriptor derivedTypes []*types.Type // slice of previously computed derived types // These slices correspond to entries in the runtime dictionary. typeParamMethodExprs []readerMethodExprInfo subdicts []objInfo rtypes []typeInfo itabs []itabInfo } type readerMethodExprInfo struct { typeParamIdx int method *types.Sym } func setType(n ir.Node, typ *types.Type) { n.SetType(typ) n.SetTypecheck(1) } func setValue(name *ir.Name, val constant.Value) { name.SetVal(val) name.Defn = nil } // @@@ Positions // pos reads a position from the bitstream. func (r *reader) pos() src.XPos { return base.Ctxt.PosTable.XPos(r.pos0()) } func (r *reader) pos0() src.Pos { r.Sync(pkgbits.SyncPos) if !r.Bool() { return src.NoPos } posBase := r.posBase() line := r.Uint() col := r.Uint() return src.MakePos(posBase, line, col) } // posBase reads a position base from the bitstream. func (r *reader) posBase() *src.PosBase { return r.inlPosBase(r.p.posBaseIdx(r.Reloc(pkgbits.RelocPosBase))) } // posBaseIdx returns the specified position base, reading it first if // needed. func (pr *pkgReader) posBaseIdx(idx pkgbits.Index) *src.PosBase { if b := pr.posBases[idx]; b != nil { return b } r := pr.newReader(pkgbits.RelocPosBase, idx, pkgbits.SyncPosBase) var b *src.PosBase absFilename := r.String() filename := absFilename // For build artifact stability, the export data format only // contains the "absolute" filename as returned by objabi.AbsFile. // However, some tests (e.g., test/run.go's asmcheck tests) expect // to see the full, original filename printed out. Re-expanding // "$GOROOT" to buildcfg.GOROOT is a close-enough approximation to // satisfy this. // // TODO(mdempsky): De-duplicate this logic with similar logic in // cmd/link/internal/ld's expandGoroot. However, this will probably // require being more consistent about when we use native vs UNIX // file paths. const dollarGOROOT = "$GOROOT" if buildcfg.GOROOT != "" && strings.HasPrefix(filename, dollarGOROOT) { filename = buildcfg.GOROOT + filename[len(dollarGOROOT):] } if r.Bool() { b = src.NewFileBase(filename, absFilename) } else { pos := r.pos0() line := r.Uint() col := r.Uint() b = src.NewLinePragmaBase(pos, filename, absFilename, line, col) } pr.posBases[idx] = b return b } // inlPosBase returns the inlining-adjusted src.PosBase corresponding // to oldBase, which must be a non-inlined position. When not // inlining, this is just oldBase. func (r *reader) inlPosBase(oldBase *src.PosBase) *src.PosBase { if index := oldBase.InliningIndex(); index >= 0 { base.Fatalf("oldBase %v already has inlining index %v", oldBase, index) } if r.inlCall == nil || r.suppressInlPos != 0 { return oldBase } if newBase, ok := r.inlPosBases[oldBase]; ok { return newBase } newBase := src.NewInliningBase(oldBase, r.inlTreeIndex) r.inlPosBases[oldBase] = newBase return newBase } // inlPos returns the inlining-adjusted src.XPos corresponding to // xpos, which must be a non-inlined position. When not inlining, this // is just xpos. func (r *reader) inlPos(xpos src.XPos) src.XPos { pos := base.Ctxt.PosTable.Pos(xpos) pos.SetBase(r.inlPosBase(pos.Base())) return base.Ctxt.PosTable.XPos(pos) } // @@@ Packages // pkg reads a package reference from the bitstream. func (r *reader) pkg() *types.Pkg { r.Sync(pkgbits.SyncPkg) return r.p.pkgIdx(r.Reloc(pkgbits.RelocPkg)) } // pkgIdx returns the specified package from the export data, reading // it first if needed. func (pr *pkgReader) pkgIdx(idx pkgbits.Index) *types.Pkg { if pkg := pr.pkgs[idx]; pkg != nil { return pkg } pkg := pr.newReader(pkgbits.RelocPkg, idx, pkgbits.SyncPkgDef).doPkg() pr.pkgs[idx] = pkg return pkg } // doPkg reads a package definition from the bitstream. func (r *reader) doPkg() *types.Pkg { path := r.String() switch path { case "": path = r.p.PkgPath() case "builtin": return types.BuiltinPkg case "unsafe": return types.UnsafePkg } name := r.String() pkg := types.NewPkg(path, "") if pkg.Name == "" { pkg.Name = name } else { base.Assertf(pkg.Name == name, "package %q has name %q, but want %q", pkg.Path, pkg.Name, name) } return pkg } // @@@ Types func (r *reader) typ() *types.Type { return r.typWrapped(true) } // typWrapped is like typ, but allows suppressing generation of // unnecessary wrappers as a compile-time optimization. func (r *reader) typWrapped(wrapped bool) *types.Type { return r.p.typIdx(r.typInfo(), r.dict, wrapped) } func (r *reader) typInfo() typeInfo { r.Sync(pkgbits.SyncType) if r.Bool() { return typeInfo{idx: pkgbits.Index(r.Len()), derived: true} } return typeInfo{idx: r.Reloc(pkgbits.RelocType), derived: false} } // typListIdx returns a list of the specified types, resolving derived // types within the given dictionary. func (pr *pkgReader) typListIdx(infos []typeInfo, dict *readerDict) []*types.Type { typs := make([]*types.Type, len(infos)) for i, info := range infos { typs[i] = pr.typIdx(info, dict, true) } return typs } // typIdx returns the specified type. If info specifies a derived // type, it's resolved within the given dictionary. If wrapped is // true, then method wrappers will be generated, if appropriate. func (pr *pkgReader) typIdx(info typeInfo, dict *readerDict, wrapped bool) *types.Type { idx := info.idx var where **types.Type if info.derived { where = &dict.derivedTypes[idx] idx = dict.derived[idx].idx } else { where = &pr.typs[idx] } if typ := *where; typ != nil { return typ } r := pr.newReader(pkgbits.RelocType, idx, pkgbits.SyncTypeIdx) r.dict = dict typ := r.doTyp() assert(typ != nil) // For recursive type declarations involving interfaces and aliases, // above r.doTyp() call may have already set pr.typs[idx], so just // double check and return the type. // // Example: // // type F = func(I) // // type I interface { // m(F) // } // // The writer writes data types in following index order: // // 0: func(I) // 1: I // 2: interface{m(func(I))} // // The reader resolves it in following index order: // // 0 -> 1 -> 2 -> 0 -> 1 // // and can divide in logically 2 steps: // // - 0 -> 1 : first time the reader reach type I, // it creates new named type with symbol I. // // - 2 -> 0 -> 1: the reader ends up reaching symbol I again, // now the symbol I was setup in above step, so // the reader just return the named type. // // Now, the functions called return, the pr.typs looks like below: // // - 0 -> 1 -> 2 -> 0 : [<T> I <T>] // - 0 -> 1 -> 2 : [func(I) I <T>] // - 0 -> 1 : [func(I) I interface { "".m(func("".I)) }] // // The idx 1, corresponding with type I was resolved successfully // after r.doTyp() call. if prev := *where; prev != nil { return prev } if wrapped { // Only cache if we're adding wrappers, so that other callers that // find a cached type know it was wrapped. *where = typ r.needWrapper(typ) } if !typ.IsUntyped() { types.CheckSize(typ) } return typ } func (r *reader) doTyp() *types.Type { switch tag := pkgbits.CodeType(r.Code(pkgbits.SyncType)); tag { default: panic(fmt.Sprintf("unexpected type: %v", tag)) case pkgbits.TypeBasic: return *basics[r.Len()] case pkgbits.TypeNamed: obj := r.obj() assert(obj.Op() == ir.OTYPE) return obj.Type() case pkgbits.TypeTypeParam: return r.dict.targs[r.Len()] case pkgbits.TypeArray: len := int64(r.Uint64()) return types.NewArray(r.typ(), len) case pkgbits.TypeChan: dir := dirs[r.Len()] return types.NewChan(r.typ(), dir) case pkgbits.TypeMap: return types.NewMap(r.typ(), r.typ()) case pkgbits.TypePointer: return types.NewPtr(r.typ()) case pkgbits.TypeSignature: return r.signature(types.LocalPkg, nil) case pkgbits.TypeSlice: return types.NewSlice(r.typ()) case pkgbits.TypeStruct: return r.structType() case pkgbits.TypeInterface: return r.interfaceType() case pkgbits.TypeUnion: return r.unionType() } } func (r *reader) unionType() *types.Type { terms := make([]*types.Type, r.Len()) tildes := make([]bool, len(terms)) for i := range terms { tildes[i] = r.Bool() terms[i] = r.typ() } return types.NewUnion(terms, tildes) } func (r *reader) interfaceType() *types.Type { tpkg := types.LocalPkg // TODO(mdempsky): Remove after iexport is gone. nmethods, nembeddeds := r.Len(), r.Len() implicit := nmethods == 0 && nembeddeds == 1 && r.Bool() assert(!implicit) // implicit interfaces only appear in constraints fields := make([]*types.Field, nmethods+nembeddeds) methods, embeddeds := fields[:nmethods], fields[nmethods:] for i := range methods { pos := r.pos() pkg, sym := r.selector() tpkg = pkg mtyp := r.signature(pkg, types.FakeRecv()) methods[i] = types.NewField(pos, sym, mtyp) } for i := range embeddeds { embeddeds[i] = types.NewField(src.NoXPos, nil, r.typ()) } if len(fields) == 0 { return types.Types[types.TINTER] // empty interface } return types.NewInterface(tpkg, fields, false) } func (r *reader) structType() *types.Type { tpkg := types.LocalPkg // TODO(mdempsky): Remove after iexport is gone. fields := make([]*types.Field, r.Len()) for i := range fields { pos := r.pos() pkg, sym := r.selector() tpkg = pkg ftyp := r.typ() tag := r.String() embedded := r.Bool() f := types.NewField(pos, sym, ftyp) f.Note = tag if embedded { f.Embedded = 1 } fields[i] = f } return types.NewStruct(tpkg, fields) } func (r *reader) signature(tpkg *types.Pkg, recv *types.Field) *types.Type { r.Sync(pkgbits.SyncSignature) params := r.params(&tpkg) results := r.params(&tpkg) if r.Bool() { // variadic params[len(params)-1].SetIsDDD(true) } return types.NewSignature(tpkg, recv, nil, params, results) } func (r *reader) params(tpkg **types.Pkg) []*types.Field { r.Sync(pkgbits.SyncParams) fields := make([]*types.Field, r.Len()) for i := range fields { *tpkg, fields[i] = r.param() } return fields } func (r *reader) param() (*types.Pkg, *types.Field) { r.Sync(pkgbits.SyncParam) pos := r.pos() pkg, sym := r.localIdent() typ := r.typ() return pkg, types.NewField(pos, sym, typ) } // @@@ Objects // objReader maps qualified identifiers (represented as *types.Sym) to // a pkgReader and corresponding index that can be used for reading // that object's definition. var objReader = map[*types.Sym]pkgReaderIndex{} // obj reads an instantiated object reference from the bitstream. func (r *reader) obj() ir.Node { return r.p.objInstIdx(r.objInfo(), r.dict, false) } // objInfo reads an instantiated object reference from the bitstream // and returns the encoded reference to it, without instantiating it. func (r *reader) objInfo() objInfo { r.Sync(pkgbits.SyncObject) assert(!r.Bool()) // TODO(mdempsky): Remove; was derived func inst. idx := r.Reloc(pkgbits.RelocObj) explicits := make([]typeInfo, r.Len()) for i := range explicits { explicits[i] = r.typInfo() } return objInfo{idx, explicits} } // objInstIdx returns the encoded, instantiated object. If shaped is // true, then the shaped variant of the object is returned instead. func (pr *pkgReader) objInstIdx(info objInfo, dict *readerDict, shaped bool) ir.Node { explicits := pr.typListIdx(info.explicits, dict) var implicits []*types.Type if dict != nil { implicits = dict.targs } return pr.objIdx(info.idx, implicits, explicits, shaped) } // objIdx returns the specified object, instantiated with the given // type arguments, if any. If shaped is true, then the shaped variant // of the object is returned instead. func (pr *pkgReader) objIdx(idx pkgbits.Index, implicits, explicits []*types.Type, shaped bool) ir.Node { rname := pr.newReader(pkgbits.RelocName, idx, pkgbits.SyncObject1) _, sym := rname.qualifiedIdent() tag := pkgbits.CodeObj(rname.Code(pkgbits.SyncCodeObj)) if tag == pkgbits.ObjStub { assert(!sym.IsBlank()) switch sym.Pkg { case types.BuiltinPkg, types.UnsafePkg: return sym.Def.(ir.Node) } if pri, ok := objReader[sym]; ok { return pri.pr.objIdx(pri.idx, nil, explicits, shaped) } base.Fatalf("unresolved stub: %v", sym) } dict := pr.objDictIdx(sym, idx, implicits, explicits, shaped) sym = dict.baseSym if !sym.IsBlank() && sym.Def != nil { return sym.Def.(*ir.Name) } r := pr.newReader(pkgbits.RelocObj, idx, pkgbits.SyncObject1) rext := pr.newReader(pkgbits.RelocObjExt, idx, pkgbits.SyncObject1) r.dict = dict rext.dict = dict do := func(op ir.Op, hasTParams bool) *ir.Name { pos := r.pos() setBasePos(pos) if hasTParams { r.typeParamNames() } name := ir.NewDeclNameAt(pos, op, sym) name.Class = ir.PEXTERN // may be overridden later if !sym.IsBlank() { if sym.Def != nil { base.FatalfAt(name.Pos(), "already have a definition for %v", name) } assert(sym.Def == nil) sym.Def = name } return name } switch tag { default: panic("unexpected object") case pkgbits.ObjAlias: name := do(ir.OTYPE, false) setType(name, r.typ()) name.SetAlias(true) return name case pkgbits.ObjConst: name := do(ir.OLITERAL, false) typ := r.typ() val := FixValue(typ, r.Value()) setType(name, typ) setValue(name, val) return name case pkgbits.ObjFunc: if sym.Name == "init" { sym = Renameinit() } name := do(ir.ONAME, true) setType(name, r.signature(sym.Pkg, nil)) name.Func = ir.NewFunc(r.pos()) name.Func.Nname = name if r.hasTypeParams() { name.Func.SetDupok(true) if r.dict.shaped { setType(name, shapeSig(name.Func, r.dict)) } else { todoDicts = append(todoDicts, func() { r.dict.shapedObj = pr.objIdx(idx, implicits, explicits, true).(*ir.Name) }) } } rext.funcExt(name, nil) return name case pkgbits.ObjType: name := do(ir.OTYPE, true) typ := types.NewNamed(name) setType(name, typ) if r.hasTypeParams() && r.dict.shaped { typ.SetHasShape(true) } // Important: We need to do this before SetUnderlying. rext.typeExt(name) // We need to defer CheckSize until we've called SetUnderlying to // handle recursive types. types.DeferCheckSize() typ.SetUnderlying(r.typWrapped(false)) types.ResumeCheckSize() if r.hasTypeParams() && !r.dict.shaped { todoDicts = append(todoDicts, func() { r.dict.shapedObj = pr.objIdx(idx, implicits, explicits, true).(*ir.Name) }) } methods := make([]*types.Field, r.Len()) for i := range methods { methods[i] = r.method(rext) } if len(methods) != 0 { typ.Methods().Set(methods) } if !r.dict.shaped { r.needWrapper(typ) } return name case pkgbits.ObjVar: name := do(ir.ONAME, false) setType(name, r.typ()) rext.varExt(name) return name } } func (dict *readerDict) mangle(sym *types.Sym) *types.Sym { if !dict.hasTypeParams() { return sym } // If sym is a locally defined generic type, we need the suffix to // stay at the end after mangling so that types/fmt.go can strip it // out again when writing the type's runtime descriptor (#54456). base, suffix := types.SplitVargenSuffix(sym.Name) var buf strings.Builder buf.WriteString(base) buf.WriteByte('[') for i, targ := range dict.targs { if i > 0 { if i == dict.implicits { buf.WriteByte(';') } else { buf.WriteByte(',') } } buf.WriteString(targ.LinkString()) } buf.WriteByte(']') buf.WriteString(suffix) return sym.Pkg.Lookup(buf.String()) } // shapify returns the shape type for targ. // // If basic is true, then the type argument is used to instantiate a // type parameter whose constraint is a basic interface. func shapify(targ *types.Type, basic bool) *types.Type { base.Assertf(targ.Kind() != types.TFORW, "%v is missing its underlying type", targ) // When a pointer type is used to instantiate a type parameter // constrained by a basic interface, we know the pointer's element // type can't matter to the generated code. In this case, we can use // an arbitrary pointer type as the shape type. (To match the // non-unified frontend, we use `*byte`.) // // Otherwise, we simply use the type's underlying type as its shape. // // TODO(mdempsky): It should be possible to do much more aggressive // shaping still; e.g., collapsing all pointer-shaped types into a // common type, collapsing scalars of the same size/alignment into a // common type, recursively shaping the element types of composite // types, and discarding struct field names and tags. However, we'll // need to start tracking how type parameters are actually used to // implement some of these optimizations. under := targ.Underlying() if basic && targ.IsPtr() && !targ.Elem().NotInHeap() { under = types.NewPtr(types.Types[types.TUINT8]) } sym := types.ShapePkg.Lookup(under.LinkString()) if sym.Def == nil { name := ir.NewDeclNameAt(under.Pos(), ir.OTYPE, sym) typ := types.NewNamed(name) typ.SetUnderlying(under) sym.Def = typed(typ, name) } res := sym.Def.Type() assert(res.IsShape()) assert(res.HasShape()) return res } // objDictIdx reads and returns the specified object dictionary. func (pr *pkgReader) objDictIdx(sym *types.Sym, idx pkgbits.Index, implicits, explicits []*types.Type, shaped bool) *readerDict { r := pr.newReader(pkgbits.RelocObjDict, idx, pkgbits.SyncObject1) dict := readerDict{ shaped: shaped, } nimplicits := r.Len() nexplicits := r.Len() if nimplicits > len(implicits) || nexplicits != len(explicits) { base.Fatalf("%v has %v+%v params, but instantiated with %v+%v args", sym, nimplicits, nexplicits, len(implicits), len(explicits)) } dict.targs = append(implicits[:nimplicits:nimplicits], explicits...) dict.implicits = nimplicits // Within the compiler, we can just skip over the type parameters. for range dict.targs[dict.implicits:] { // Skip past bounds without actually evaluating them. r.typInfo() } dict.derived = make([]derivedInfo, r.Len()) dict.derivedTypes = make([]*types.Type, len(dict.derived)) for i := range dict.derived { dict.derived[i] = derivedInfo{r.Reloc(pkgbits.RelocType), r.Bool()} } // Runtime dictionary information; private to the compiler. // If any type argument is already shaped, then we're constructing a // shaped object, even if not explicitly requested (i.e., calling // objIdx with shaped==true). This can happen with instantiating // types that are referenced within a function body. for _, targ := range dict.targs { if targ.HasShape() { dict.shaped = true break } } // And if we're constructing a shaped object, then shapify all type // arguments. for i, targ := range dict.targs { basic := r.Bool() if dict.shaped { dict.targs[i] = shapify(targ, basic) } } dict.baseSym = dict.mangle(sym) dict.typeParamMethodExprs = make([]readerMethodExprInfo, r.Len()) for i := range dict.typeParamMethodExprs { typeParamIdx := r.Len() _, method := r.selector() dict.typeParamMethodExprs[i] = readerMethodExprInfo{typeParamIdx, method} } dict.subdicts = make([]objInfo, r.Len()) for i := range dict.subdicts { dict.subdicts[i] = r.objInfo() } dict.rtypes = make([]typeInfo, r.Len()) for i := range dict.rtypes { dict.rtypes[i] = r.typInfo() } dict.itabs = make([]itabInfo, r.Len()) for i := range dict.itabs { dict.itabs[i] = itabInfo{typ: r.typInfo(), iface: r.typInfo()} } return &dict } func (r *reader) typeParamNames() { r.Sync(pkgbits.SyncTypeParamNames) for range r.dict.targs[r.dict.implicits:] { r.pos() r.localIdent() } } func (r *reader) method(rext *reader) *types.Field { r.Sync(pkgbits.SyncMethod) pos := r.pos() pkg, sym := r.selector() r.typeParamNames() _, recv := r.param() typ := r.signature(pkg, recv) name := ir.NewNameAt(pos, ir.MethodSym(recv.Type, sym)) setType(name, typ) name.Func = ir.NewFunc(r.pos()) name.Func.Nname = name if r.hasTypeParams() { name.Func.SetDupok(true) if r.dict.shaped { typ = shapeSig(name.Func, r.dict) setType(name, typ) } } rext.funcExt(name, sym) meth := types.NewField(name.Func.Pos(), sym, typ) meth.Nname = name meth.SetNointerface(name.Func.Pragma&ir.Nointerface != 0) return meth } func (r *reader) qualifiedIdent() (pkg *types.Pkg, sym *types.Sym) { r.Sync(pkgbits.SyncSym) pkg = r.pkg() if name := r.String(); name != "" { sym = pkg.Lookup(name) } return } func (r *reader) localIdent() (pkg *types.Pkg, sym *types.Sym) { r.Sync(pkgbits.SyncLocalIdent) pkg = r.pkg() if name := r.String(); name != "" { sym = pkg.Lookup(name) } return } func (r *reader) selector() (origPkg *types.Pkg, sym *types.Sym) { r.Sync(pkgbits.SyncSelector) origPkg = r.pkg() name := r.String() pkg := origPkg if types.IsExported(name) { pkg = types.LocalPkg } sym = pkg.Lookup(name) return } func (r *reader) hasTypeParams() bool { return r.dict.hasTypeParams() } func (dict *readerDict) hasTypeParams() bool { return dict != nil && len(dict.targs) != 0 } // @@@ Compiler extensions func (r *reader) funcExt(name *ir.Name, method *types.Sym) { r.Sync(pkgbits.SyncFuncExt) name.Class = 0 // so MarkFunc doesn't complain ir.MarkFunc(name) fn := name.Func // XXX: Workaround because linker doesn't know how to copy Pos. if !fn.Pos().IsKnown() { fn.SetPos(name.Pos()) } // Normally, we only compile local functions, which saves redundant compilation work. // n.Defn is not nil for local functions, and is nil for imported function. But for // generic functions, we might have an instantiation that no other package has seen before. // So we need to be conservative and compile it again. // // That's why name.Defn is set here, so ir.VisitFuncsBottomUp can analyze function. // TODO(mdempsky,cuonglm): find a cleaner way to handle this. if name.Sym().Pkg == types.LocalPkg || r.hasTypeParams() { name.Defn = fn } fn.Pragma = r.pragmaFlag() r.linkname(name) typecheck.Func(fn) if r.Bool() { assert(name.Defn == nil) fn.ABI = obj.ABI(r.Uint64()) // Escape analysis. for _, fs := range &types.RecvsParams { for _, f := range fs(name.Type()).FieldSlice() { f.Note = r.String() } } if r.Bool() { fn.Inl = &ir.Inline{ Cost: int32(r.Len()), CanDelayResults: r.Bool(), } } } else { r.addBody(name.Func, method) } r.Sync(pkgbits.SyncEOF) } func (r *reader) typeExt(name *ir.Name) { r.Sync(pkgbits.SyncTypeExt) typ := name.Type() if r.hasTypeParams() { // Set "RParams" (really type arguments here, not parameters) so // this type is treated as "fully instantiated". This ensures the // type descriptor is written out as DUPOK and method wrappers are // generated even for imported types. var targs []*types.Type targs = append(targs, r.dict.targs...) typ.SetRParams(targs) } name.SetPragma(r.pragmaFlag()) if name.Pragma()&ir.NotInHeap != 0 { typ.SetNotInHeap(true) } typecheck.SetBaseTypeIndex(typ, r.Int64(), r.Int64()) } func (r *reader) varExt(name *ir.Name) { r.Sync(pkgbits.SyncVarExt) r.linkname(name) } func (r *reader) linkname(name *ir.Name) { assert(name.Op() == ir.ONAME) r.Sync(pkgbits.SyncLinkname) if idx := r.Int64(); idx >= 0 { lsym := name.Linksym() lsym.SymIdx = int32(idx) lsym.Set(obj.AttrIndexed, true) } else { name.Sym().Linkname = r.String() } } func (r *reader) pragmaFlag() ir.PragmaFlag { r.Sync(pkgbits.SyncPragma) return ir.PragmaFlag(r.Int()) } // @@@ Function bodies // bodyReader tracks where the serialized IR for a local or imported, // generic function's body can be found. var bodyReader = map[*ir.Func]pkgReaderIndex{} // importBodyReader tracks where the serialized IR for an imported, // static (i.e., non-generic) function body can be read. var importBodyReader = map[*types.Sym]pkgReaderIndex{} // bodyReaderFor returns the pkgReaderIndex for reading fn's // serialized IR, and whether one was found. func bodyReaderFor(fn *ir.Func) (pri pkgReaderIndex, ok bool) { if fn.Nname.Defn != nil { pri, ok = bodyReader[fn] base.AssertfAt(ok, base.Pos, "must have bodyReader for %v", fn) // must always be available } else { pri, ok = importBodyReader[fn.Sym()] } return } // todoDicts holds the list of dictionaries that still need their // runtime dictionary objects constructed. var todoDicts []func() // todoBodies holds the list of function bodies that still need to be // constructed. var todoBodies []*ir.Func // addBody reads a function body reference from the element bitstream, // and associates it with fn. func (r *reader) addBody(fn *ir.Func, method *types.Sym) { // addBody should only be called for local functions or imported // generic functions; see comment in funcExt. assert(fn.Nname.Defn != nil) idx := r.Reloc(pkgbits.RelocBody) pri := pkgReaderIndex{r.p, idx, r.dict, method, nil} bodyReader[fn] = pri if r.curfn == nil { todoBodies = append(todoBodies, fn) return } pri.funcBody(fn) } func (pri pkgReaderIndex) funcBody(fn *ir.Func) { r := pri.asReader(pkgbits.RelocBody, pkgbits.SyncFuncBody) r.funcBody(fn) } // funcBody reads a function body definition from the element // bitstream, and populates fn with it. func (r *reader) funcBody(fn *ir.Func) { r.curfn = fn r.closureVars = fn.ClosureVars if len(r.closureVars) != 0 && r.hasTypeParams() { r.dictParam = r.closureVars[len(r.closureVars)-1] // dictParam is last; see reader.funcLit } ir.WithFunc(fn, func() { r.funcargs(fn) if r.syntheticBody(fn.Pos()) { return } if !r.Bool() { return } body := r.stmts() if body == nil { body = []ir.Node{typecheck.Stmt(ir.NewBlockStmt(src.NoXPos, nil))} } fn.Body = body fn.Endlineno = r.pos() }) r.marker.WriteTo(fn) } // syntheticBody adds a synthetic body to r.curfn if appropriate, and // reports whether it did. func (r *reader) syntheticBody(pos src.XPos) bool { if r.synthetic != nil { r.synthetic(pos, r) return true } // If this function has type parameters and isn't shaped, then we // just tail call its corresponding shaped variant. if r.hasTypeParams() && !r.dict.shaped { r.callShaped(pos) return true } return false } // callShaped emits a tail call to r.shapedFn, passing along the // arguments to the current function. func (r *reader) callShaped(pos src.XPos) { shapedObj := r.dict.shapedObj assert(shapedObj != nil) var shapedFn ir.Node if r.methodSym == nil { // Instantiating a generic function; shapedObj is the shaped // function itself. assert(shapedObj.Op() == ir.ONAME && shapedObj.Class == ir.PFUNC) shapedFn = shapedObj } else { // Instantiating a generic type's method; shapedObj is the shaped // type, so we need to select it's corresponding method. shapedFn = shapedMethodExpr(pos, shapedObj, r.methodSym) } recvs, params := r.syntheticArgs(pos) // Construct the arguments list: receiver (if any), then runtime // dictionary, and finally normal parameters. // // Note: For simplicity, shaped methods are added as normal methods // on their shaped types. So existing code (e.g., packages ir and // typecheck) expects the shaped type to appear as the receiver // parameter (or first parameter, as a method expression). Hence // putting the dictionary parameter after that is the least invasive // solution at the moment. var args ir.Nodes args.Append(recvs...) args.Append(typecheck.Expr(ir.NewAddrExpr(pos, r.p.dictNameOf(r.dict)))) args.Append(params...) r.syntheticTailCall(pos, shapedFn, args) } // syntheticArgs returns the recvs and params arguments passed to the // current function. func (r *reader) syntheticArgs(pos src.XPos) (recvs, params ir.Nodes) { sig := r.curfn.Nname.Type() inlVarIdx := 0 addParams := func(out *ir.Nodes, params []*types.Field) { for _, param := range params { var arg ir.Node if param.Nname != nil { name := param.Nname.(*ir.Name) if !ir.IsBlank(name) { if r.inlCall != nil { // During inlining, we want the respective inlvar where we // assigned the callee's arguments. arg = r.inlvars[inlVarIdx] } else { // Otherwise, we can use the parameter itself directly. base.AssertfAt(name.Curfn == r.curfn, name.Pos(), "%v has curfn %v, but want %v", name, name.Curfn, r.curfn) arg = name } } } // For anonymous and blank parameters, we don't have an *ir.Name // to use as the argument. However, since we know the shaped // function won't use the value either, we can just pass the // zero value. (Also unfortunately, we don't have an easy // zero-value IR node; so we use a default-initialized temporary // variable.) if arg == nil { tmp := typecheck.TempAt(pos, r.curfn, param.Type) r.curfn.Body.Append( typecheck.Stmt(ir.NewDecl(pos, ir.ODCL, tmp)), typecheck.Stmt(ir.NewAssignStmt(pos, tmp, nil)), ) arg = tmp } out.Append(arg) inlVarIdx++ } } addParams(&recvs, sig.Recvs().FieldSlice()) addParams(¶ms, sig.Params().FieldSlice()) return } // syntheticTailCall emits a tail call to fn, passing the given // arguments list. func (r *reader) syntheticTailCall(pos src.XPos, fn ir.Node, args ir.Nodes) { // Mark the function as a wrapper so it doesn't show up in stack // traces. r.curfn.SetWrapper(true) call := typecheck.Call(pos, fn, args, fn.Type().IsVariadic()).(*ir.CallExpr) var stmt ir.Node if fn.Type().NumResults() != 0 { stmt = typecheck.Stmt(ir.NewReturnStmt(pos, []ir.Node{call})) } else { stmt = call } r.curfn.Body.Append(stmt) } // dictNameOf returns the runtime dictionary corresponding to dict. func (pr *pkgReader) dictNameOf(dict *readerDict) *ir.Name { pos := base.AutogeneratedPos // Check that we only instantiate runtime dictionaries with real types. base.AssertfAt(!dict.shaped, pos, "runtime dictionary of shaped object %v", dict.baseSym) sym := dict.baseSym.Pkg.Lookup(objabi.GlobalDictPrefix + "." + dict.baseSym.Name) if sym.Def != nil { return sym.Def.(*ir.Name) } name := ir.NewNameAt(pos, sym) name.Class = ir.PEXTERN sym.Def = name // break cycles with mutual subdictionaries lsym := name.Linksym() ot := 0 assertOffset := func(section string, offset int) { base.AssertfAt(ot == offset*types.PtrSize, pos, "writing section %v at offset %v, but it should be at %v*%v", section, ot, offset, types.PtrSize) } assertOffset("type param method exprs", dict.typeParamMethodExprsOffset()) for _, info := range dict.typeParamMethodExprs { typeParam := dict.targs[info.typeParamIdx] method := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(typeParam), info.method)).(*ir.SelectorExpr) assert(method.Op() == ir.OMETHEXPR) rsym := method.FuncName().Linksym() assert(rsym.ABI() == obj.ABIInternal) // must be ABIInternal; see ir.OCFUNC in ssagen/ssa.go ot = objw.SymPtr(lsym, ot, rsym, 0) } assertOffset("subdictionaries", dict.subdictsOffset()) for _, info := range dict.subdicts { explicits := pr.typListIdx(info.explicits, dict) // Careful: Due to subdictionary cycles, name may not be fully // initialized yet. name := pr.objDictName(info.idx, dict.targs, explicits) ot = objw.SymPtr(lsym, ot, name.Linksym(), 0) } assertOffset("rtypes", dict.rtypesOffset()) for _, info := range dict.rtypes { typ := pr.typIdx(info, dict, true) ot = objw.SymPtr(lsym, ot, reflectdata.TypeLinksym(typ), 0) // TODO(mdempsky): Double check this. reflectdata.MarkTypeUsedInInterface(typ, lsym) } // For each (typ, iface) pair, we write *runtime._type pointers // for typ and iface, as well as the *runtime.itab pointer for the // pair. This is wasteful, but it simplifies worrying about tricky // cases like instantiating type parameters with interface types. // // TODO(mdempsky): Add the needed *runtime._type pointers into the // rtypes section above instead, and omit itabs entries when we // statically know it won't be needed. assertOffset("itabs", dict.itabsOffset()) for _, info := range dict.itabs { typ := pr.typIdx(info.typ, dict, true) iface := pr.typIdx(info.iface, dict, true) if !iface.IsInterface() { ot += 3 * types.PtrSize continue } ot = objw.SymPtr(lsym, ot, reflectdata.TypeLinksym(typ), 0) ot = objw.SymPtr(lsym, ot, reflectdata.TypeLinksym(iface), 0) if !typ.IsInterface() && !iface.IsEmptyInterface() { ot = objw.SymPtr(lsym, ot, reflectdata.ITabLsym(typ, iface), 0) } else { ot += types.PtrSize } // TODO(mdempsky): Double check this. reflectdata.MarkTypeUsedInInterface(typ, lsym) reflectdata.MarkTypeUsedInInterface(iface, lsym) } objw.Global(lsym, int32(ot), obj.DUPOK|obj.RODATA) name.SetType(dict.varType()) name.SetTypecheck(1) return name } // typeParamMethodExprsOffset returns the offset of the runtime // dictionary's type parameter method expressions section, in words. func (dict *readerDict) typeParamMethodExprsOffset() int { return 0 } // subdictsOffset returns the offset of the runtime dictionary's // subdictionary section, in words. func (dict *readerDict) subdictsOffset() int { return dict.typeParamMethodExprsOffset() + len(dict.typeParamMethodExprs) } // rtypesOffset returns the offset of the runtime dictionary's rtypes // section, in words. func (dict *readerDict) rtypesOffset() int { return dict.subdictsOffset() + len(dict.subdicts) } // itabsOffset returns the offset of the runtime dictionary's itabs // section, in words. func (dict *readerDict) itabsOffset() int { return dict.rtypesOffset() + len(dict.rtypes) } // numWords returns the total number of words that comprise dict's // runtime dictionary variable. func (dict *readerDict) numWords() int64 { return int64(dict.itabsOffset() + 3*len(dict.itabs)) } // varType returns the type of dict's runtime dictionary variable. func (dict *readerDict) varType() *types.Type { return types.NewArray(types.Types[types.TUINTPTR], dict.numWords()) } func (r *reader) funcargs(fn *ir.Func) { sig := fn.Nname.Type() if recv := sig.Recv(); recv != nil { r.funcarg(recv, recv.Sym, ir.PPARAM) } for _, param := range sig.Params().FieldSlice() { r.funcarg(param, param.Sym, ir.PPARAM) } for i, param := range sig.Results().FieldSlice() { sym := types.OrigSym(param.Sym) if sym == nil || sym.IsBlank() { prefix := "~r" if r.inlCall != nil { prefix = "~R" } else if sym != nil { prefix = "~b" } sym = typecheck.LookupNum(prefix, i) } r.funcarg(param, sym, ir.PPARAMOUT) } } func (r *reader) funcarg(param *types.Field, sym *types.Sym, ctxt ir.Class) { if sym == nil { assert(ctxt == ir.PPARAM) if r.inlCall != nil { r.inlvars.Append(ir.BlankNode) } return } name := ir.NewNameAt(r.inlPos(param.Pos), sym) setType(name, param.Type) r.addLocal(name, ctxt) if r.inlCall == nil { if !r.funarghack { param.Sym = sym param.Nname = name } } else { if ctxt == ir.PPARAMOUT { r.retvars.Append(name) } else { r.inlvars.Append(name) } } } func (r *reader) addLocal(name *ir.Name, ctxt ir.Class) { assert(ctxt == ir.PAUTO || ctxt == ir.PPARAM || ctxt == ir.PPARAMOUT) if name.Sym().Name == dictParamName { r.dictParam = name } else { if r.synthetic == nil { r.Sync(pkgbits.SyncAddLocal) if r.p.SyncMarkers() { want := r.Int() if have := len(r.locals); have != want { base.FatalfAt(name.Pos(), "locals table has desynced") } } r.varDictIndex(name) } r.locals = append(r.locals, name) } name.SetUsed(true) // TODO(mdempsky): Move earlier. if ir.IsBlank(name) { return } if r.inlCall != nil { if ctxt == ir.PAUTO { name.SetInlLocal(true) } else { name.SetInlFormal(true) ctxt = ir.PAUTO } // TODO(mdempsky): Rethink this hack. if strings.HasPrefix(name.Sym().Name, "~") || base.Flag.GenDwarfInl == 0 { name.SetPos(r.inlCall.Pos()) name.SetInlFormal(false) name.SetInlLocal(false) } } name.Class = ctxt name.Curfn = r.curfn r.curfn.Dcl = append(r.curfn.Dcl, name) if ctxt == ir.PAUTO { name.SetFrameOffset(0) } } func (r *reader) useLocal() *ir.Name { r.Sync(pkgbits.SyncUseObjLocal) if r.Bool() { return r.locals[r.Len()] } return r.closureVars[r.Len()] } func (r *reader) openScope() { r.Sync(pkgbits.SyncOpenScope) pos := r.pos() if base.Flag.Dwarf { r.scopeVars = append(r.scopeVars, len(r.curfn.Dcl)) r.marker.Push(pos) } } func (r *reader) closeScope() { r.Sync(pkgbits.SyncCloseScope) r.lastCloseScopePos = r.pos() r.closeAnotherScope() } // closeAnotherScope is like closeScope, but it reuses the same mark // position as the last closeScope call. This is useful for "for" and // "if" statements, as their implicit blocks always end at the same // position as an explicit block. func (r *reader) closeAnotherScope() { r.Sync(pkgbits.SyncCloseAnotherScope) if base.Flag.Dwarf { scopeVars := r.scopeVars[len(r.scopeVars)-1] r.scopeVars = r.scopeVars[:len(r.scopeVars)-1] // Quirkish: noder decides which scopes to keep before // typechecking, whereas incremental typechecking during IR // construction can result in new autotemps being allocated. To // produce identical output, we ignore autotemps here for the // purpose of deciding whether to retract the scope. // // This is important for net/http/fcgi, because it contains: // // var body io.ReadCloser // if len(content) > 0 { // body, req.pw = io.Pipe() // } else { … } // // Notably, io.Pipe is inlinable, and inlining it introduces a ~R0 // variable at the call site. // // Noder does not preserve the scope where the io.Pipe() call // resides, because it doesn't contain any declared variables in // source. So the ~R0 variable ends up being assigned to the // enclosing scope instead. // // However, typechecking this assignment also introduces // autotemps, because io.Pipe's results need conversion before // they can be assigned to their respective destination variables. // // TODO(mdempsky): We should probably just keep all scopes, and // let dwarfgen take care of pruning them instead. retract := true for _, n := range r.curfn.Dcl[scopeVars:] { if !n.AutoTemp() { retract = false break } } if retract { // no variables were declared in this scope, so we can retract it. r.marker.Unpush() } else { r.marker.Pop(r.lastCloseScopePos) } } } // @@@ Statements func (r *reader) stmt() ir.Node { switch stmts := r.stmts(); len(stmts) { case 0: return nil case 1: return stmts[0] default: return ir.NewBlockStmt(stmts[0].Pos(), stmts) } } func (r *reader) stmts() []ir.Node { assert(ir.CurFunc == r.curfn) var res ir.Nodes r.Sync(pkgbits.SyncStmts) for { tag := codeStmt(r.Code(pkgbits.SyncStmt1)) if tag == stmtEnd { r.Sync(pkgbits.SyncStmtsEnd) return res } if n := r.stmt1(tag, &res); n != nil { res.Append(typecheck.Stmt(n)) } } } func (r *reader) stmt1(tag codeStmt, out *ir.Nodes) ir.Node { var label *types.Sym if n := len(*out); n > 0 { if ls, ok := (*out)[n-1].(*ir.LabelStmt); ok { label = ls.Label } } switch tag { default: panic("unexpected statement") case stmtAssign: pos := r.pos() names, lhs := r.assignList() rhs := r.multiExpr() if len(rhs) == 0 { for _, name := range names { as := ir.NewAssignStmt(pos, name, nil) as.PtrInit().Append(ir.NewDecl(pos, ir.ODCL, name)) out.Append(typecheck.Stmt(as)) } return nil } if len(lhs) == 1 && len(rhs) == 1 { n := ir.NewAssignStmt(pos, lhs[0], rhs[0]) n.Def = r.initDefn(n, names) return n } n := ir.NewAssignListStmt(pos, ir.OAS2, lhs, rhs) n.Def = r.initDefn(n, names) return n case stmtAssignOp: op := r.op() lhs := r.expr() pos := r.pos() rhs := r.expr() return ir.NewAssignOpStmt(pos, op, lhs, rhs) case stmtIncDec: op := r.op() lhs := r.expr() pos := r.pos() n := ir.NewAssignOpStmt(pos, op, lhs, ir.NewBasicLit(pos, one)) n.IncDec = true return n case stmtBlock: out.Append(r.blockStmt()...) return nil case stmtBranch: pos := r.pos() op := r.op() sym := r.optLabel() return ir.NewBranchStmt(pos, op, sym) case stmtCall: pos := r.pos() op := r.op() call := r.expr() return ir.NewGoDeferStmt(pos, op, call) case stmtExpr: return r.expr() case stmtFor: return r.forStmt(label) case stmtIf: return r.ifStmt() case stmtLabel: pos := r.pos() sym := r.label() return ir.NewLabelStmt(pos, sym) case stmtReturn: pos := r.pos() results := r.multiExpr() return ir.NewReturnStmt(pos, results) case stmtSelect: return r.selectStmt(label) case stmtSend: pos := r.pos() ch := r.expr() value := r.expr() return ir.NewSendStmt(pos, ch, value) case stmtSwitch: return r.switchStmt(label) } } func (r *reader) assignList() ([]*ir.Name, []ir.Node) { lhs := make([]ir.Node, r.Len()) var names []*ir.Name for i := range lhs { expr, def := r.assign() lhs[i] = expr if def { names = append(names, expr.(*ir.Name)) } } return names, lhs } // assign returns an assignee expression. It also reports whether the // returned expression is a newly declared variable. func (r *reader) assign() (ir.Node, bool) { switch tag := codeAssign(r.Code(pkgbits.SyncAssign)); tag { default: panic("unhandled assignee expression") case assignBlank: return typecheck.AssignExpr(ir.BlankNode), false case assignDef: pos := r.pos() setBasePos(pos) _, sym := r.localIdent() typ := r.typ() name := ir.NewNameAt(pos, sym) setType(name, typ) r.addLocal(name, ir.PAUTO) return name, true case assignExpr: return r.expr(), false } } func (r *reader) blockStmt() []ir.Node { r.Sync(pkgbits.SyncBlockStmt) r.openScope() stmts := r.stmts() r.closeScope() return stmts } func (r *reader) forStmt(label *types.Sym) ir.Node { r.Sync(pkgbits.SyncForStmt) r.openScope() if r.Bool() { pos := r.pos() rang := ir.NewRangeStmt(pos, nil, nil, nil, nil) rang.Label = label names, lhs := r.assignList() if len(lhs) >= 1 { rang.Key = lhs[0] if len(lhs) >= 2 { rang.Value = lhs[1] } } rang.Def = r.initDefn(rang, names) rang.X = r.expr() if rang.X.Type().IsMap() { rang.RType = r.rtype(pos) } if rang.Key != nil && !ir.IsBlank(rang.Key) { rang.KeyTypeWord, rang.KeySrcRType = r.convRTTI(pos) } if rang.Value != nil && !ir.IsBlank(rang.Value) { rang.ValueTypeWord, rang.ValueSrcRType = r.convRTTI(pos) } rang.Body = r.blockStmt() r.closeAnotherScope() return rang } pos := r.pos() init := r.stmt() cond := r.optExpr() post := r.stmt() body := r.blockStmt() r.closeAnotherScope() stmt := ir.NewForStmt(pos, init, cond, post, body) stmt.Label = label return stmt } func (r *reader) ifStmt() ir.Node { r.Sync(pkgbits.SyncIfStmt) r.openScope() pos := r.pos() init := r.stmts() cond := r.expr() then := r.blockStmt() els := r.stmts() n := ir.NewIfStmt(pos, cond, then, els) n.SetInit(init) r.closeAnotherScope() return n } func (r *reader) selectStmt(label *types.Sym) ir.Node { r.Sync(pkgbits.SyncSelectStmt) pos := r.pos() clauses := make([]*ir.CommClause, r.Len()) for i := range clauses { if i > 0 { r.closeScope() } r.openScope() pos := r.pos() comm := r.stmt() body := r.stmts() // "case i = <-c: ..." may require an implicit conversion (e.g., // see fixedbugs/bug312.go). Currently, typecheck throws away the // implicit conversion and relies on it being reinserted later, // but that would lose any explicit RTTI operands too. To preserve // RTTI, we rewrite this as "case tmp := <-c: i = tmp; ...". if as, ok := comm.(*ir.AssignStmt); ok && as.Op() == ir.OAS && !as.Def { if conv, ok := as.Y.(*ir.ConvExpr); ok && conv.Op() == ir.OCONVIFACE { base.AssertfAt(conv.Implicit(), conv.Pos(), "expected implicit conversion: %v", conv) recv := conv.X base.AssertfAt(recv.Op() == ir.ORECV, recv.Pos(), "expected receive expression: %v", recv) tmp := r.temp(pos, recv.Type()) // Replace comm with `tmp := <-c`. tmpAs := ir.NewAssignStmt(pos, tmp, recv) tmpAs.Def = true tmpAs.PtrInit().Append(ir.NewDecl(pos, ir.ODCL, tmp)) comm = tmpAs // Change original assignment to `i = tmp`, and prepend to body. conv.X = tmp body = append([]ir.Node{as}, body...) } } // multiExpr will have desugared a comma-ok receive expression // into a separate statement. However, the rest of the compiler // expects comm to be the OAS2RECV statement itself, so we need to // shuffle things around to fit that pattern. if as2, ok := comm.(*ir.AssignListStmt); ok && as2.Op() == ir.OAS2 { init := ir.TakeInit(as2.Rhs[0]) base.AssertfAt(len(init) == 1 && init[0].Op() == ir.OAS2RECV, as2.Pos(), "unexpected assignment: %+v", as2) comm = init[0] body = append([]ir.Node{as2}, body...) } clauses[i] = ir.NewCommStmt(pos, comm, body) } if len(clauses) > 0 { r.closeScope() } n := ir.NewSelectStmt(pos, clauses) n.Label = label return n } func (r *reader) switchStmt(label *types.Sym) ir.Node { r.Sync(pkgbits.SyncSwitchStmt) r.openScope() pos := r.pos() init := r.stmt() var tag ir.Node var ident *ir.Ident var iface *types.Type if r.Bool() { pos := r.pos() if r.Bool() { pos := r.pos() sym := typecheck.Lookup(r.String()) ident = ir.NewIdent(pos, sym) } x := r.expr() iface = x.Type() tag = ir.NewTypeSwitchGuard(pos, ident, x) } else { tag = r.optExpr() } clauses := make([]*ir.CaseClause, r.Len()) for i := range clauses { if i > 0 { r.closeScope() } r.openScope() pos := r.pos() var cases, rtypes []ir.Node if iface != nil { cases = make([]ir.Node, r.Len()) if len(cases) == 0 { cases = nil // TODO(mdempsky): Unclear if this matters. } for i := range cases { if r.Bool() { // case nil cases[i] = typecheck.Expr(types.BuiltinPkg.Lookup("nil").Def.(*ir.NilExpr)) } else { cases[i] = r.exprType() } } } else { cases = r.exprList() // For `switch { case any(true): }` (e.g., issue 3980 in // test/switch.go), the backend still creates a mixed bool/any // comparison, and we need to explicitly supply the RTTI for the // comparison. // // TODO(mdempsky): Change writer.go to desugar "switch {" into // "switch true {", which we already handle correctly. if tag == nil { for i, cas := range cases { if cas.Type().IsEmptyInterface() { for len(rtypes) < i { rtypes = append(rtypes, nil) } rtypes = append(rtypes, reflectdata.TypePtrAt(cas.Pos(), types.Types[types.TBOOL])) } } } } clause := ir.NewCaseStmt(pos, cases, nil) clause.RTypes = rtypes if ident != nil { pos := r.pos() typ := r.typ() name := ir.NewNameAt(pos, ident.Sym()) setType(name, typ) r.addLocal(name, ir.PAUTO) clause.Var = name name.Defn = tag } clause.Body = r.stmts() clauses[i] = clause } if len(clauses) > 0 { r.closeScope() } r.closeScope() n := ir.NewSwitchStmt(pos, tag, clauses) n.Label = label if init != nil { n.SetInit([]ir.Node{init}) } return n } func (r *reader) label() *types.Sym { r.Sync(pkgbits.SyncLabel) name := r.String() if r.inlCall != nil { name = fmt.Sprintf("~%s·%d", name, inlgen) } return typecheck.Lookup(name) } func (r *reader) optLabel() *types.Sym { r.Sync(pkgbits.SyncOptLabel) if r.Bool() { return r.label() } return nil } // initDefn marks the given names as declared by defn and populates // its Init field with ODCL nodes. It then reports whether any names // were so declared, which can be used to initialize defn.Def. func (r *reader) initDefn(defn ir.InitNode, names []*ir.Name) bool { if len(names) == 0 { return false } init := make([]ir.Node, len(names)) for i, name := range names { name.Defn = defn init[i] = ir.NewDecl(name.Pos(), ir.ODCL, name) } defn.SetInit(init) return true } // @@@ Expressions // expr reads and returns a typechecked expression. func (r *reader) expr() (res ir.Node) { defer func() { if res != nil && res.Typecheck() == 0 { base.FatalfAt(res.Pos(), "%v missed typecheck", res) } }() switch tag := codeExpr(r.Code(pkgbits.SyncExpr)); tag { default: panic("unhandled expression") case exprLocal: return typecheck.Expr(r.useLocal()) case exprGlobal: // Callee instead of Expr allows builtins // TODO(mdempsky): Handle builtins directly in exprCall, like method calls? return typecheck.Callee(r.obj()) case exprFuncInst: pos := r.pos() wrapperFn, baseFn, dictPtr := r.funcInst(pos) if wrapperFn != nil { return wrapperFn } return r.curry(pos, false, baseFn, dictPtr, nil) case exprConst: pos := r.pos() typ := r.typ() val := FixValue(typ, r.Value()) op := r.op() orig := r.String() return typecheck.Expr(OrigConst(pos, typ, val, op, orig)) case exprNil: pos := r.pos() typ := r.typ() return Nil(pos, typ) case exprCompLit: return r.compLit() case exprFuncLit: return r.funcLit() case exprFieldVal: x := r.expr() pos := r.pos() _, sym := r.selector() return typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, x, sym)).(*ir.SelectorExpr) case exprMethodVal: recv := r.expr() pos := r.pos() wrapperFn, baseFn, dictPtr := r.methodExpr() // For simple wrapperFn values, the existing machinery for creating // and deduplicating wrapperFn value wrappers still works fine. if wrapperFn, ok := wrapperFn.(*ir.SelectorExpr); ok && wrapperFn.Op() == ir.OMETHEXPR { // The receiver expression we constructed may have a shape type. // For example, in fixedbugs/issue54343.go, `New[int]()` is // constructed as `New[go.shape.int](&.dict.New[int])`, which // has type `*T[go.shape.int]`, not `*T[int]`. // // However, the method we want to select here is `(*T[int]).M`, // not `(*T[go.shape.int]).M`, so we need to manually convert // the type back so that the OXDOT resolves correctly. // // TODO(mdempsky): Logically it might make more sense for // exprCall to take responsibility for setting a non-shaped // result type, but this is the only place where we care // currently. And only because existing ir.OMETHVALUE backend // code relies on n.X.Type() instead of n.Selection.Recv().Type // (because the latter is types.FakeRecvType() in the case of // interface method values). // if recv.Type().HasShape() { typ := wrapperFn.Type().Params().Field(0).Type if !types.Identical(typ, recv.Type()) { base.FatalfAt(wrapperFn.Pos(), "receiver %L does not match %L", recv, wrapperFn) } recv = typecheck.Expr(ir.NewConvExpr(recv.Pos(), ir.OCONVNOP, typ, recv)) } n := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, recv, wrapperFn.Sel)).(*ir.SelectorExpr) assert(n.Selection == wrapperFn.Selection) wrapper := methodValueWrapper{ rcvr: n.X.Type(), method: n.Selection, } if r.importedDef() { haveMethodValueWrappers = append(haveMethodValueWrappers, wrapper) } else { needMethodValueWrappers = append(needMethodValueWrappers, wrapper) } return n } // For more complicated method expressions, we construct a // function literal wrapper. return r.curry(pos, true, baseFn, recv, dictPtr) case exprMethodExpr: recv := r.typ() implicits := make([]int, r.Len()) for i := range implicits { implicits[i] = r.Len() } var deref, addr bool if r.Bool() { deref = true } else if r.Bool() { addr = true } pos := r.pos() wrapperFn, baseFn, dictPtr := r.methodExpr() // If we already have a wrapper and don't need to do anything with // it, we can just return the wrapper directly. // // N.B., we use implicits/deref/addr here as the source of truth // rather than types.Identical, because the latter can be confused // by tricky promoted methods (e.g., typeparam/mdempsky/21.go). if wrapperFn != nil && len(implicits) == 0 && !deref && !addr { if !types.Identical(recv, wrapperFn.Type().Params().Field(0).Type) { base.FatalfAt(pos, "want receiver type %v, but have method %L", recv, wrapperFn) } return wrapperFn } // Otherwise, if the wrapper function is a static method // expression (OMETHEXPR) and the receiver type is unshaped, then // we can rely on a statically generated wrapper being available. if method, ok := wrapperFn.(*ir.SelectorExpr); ok && method.Op() == ir.OMETHEXPR && !recv.HasShape() { return typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), method.Sel)).(*ir.SelectorExpr) } return r.methodExprWrap(pos, recv, implicits, deref, addr, baseFn, dictPtr) case exprIndex: x := r.expr() pos := r.pos() index := r.expr() n := typecheck.Expr(ir.NewIndexExpr(pos, x, index)) switch n.Op() { case ir.OINDEXMAP: n := n.(*ir.IndexExpr) n.RType = r.rtype(pos) } return n case exprSlice: x := r.expr() pos := r.pos() var index [3]ir.Node for i := range index { index[i] = r.optExpr() } op := ir.OSLICE if index[2] != nil { op = ir.OSLICE3 } return typecheck.Expr(ir.NewSliceExpr(pos, op, x, index[0], index[1], index[2])) case exprAssert: x := r.expr() pos := r.pos() typ := r.exprType() srcRType := r.rtype(pos) // TODO(mdempsky): Always emit ODYNAMICDOTTYPE for uniformity? if typ, ok := typ.(*ir.DynamicType); ok && typ.Op() == ir.ODYNAMICTYPE { assert := ir.NewDynamicTypeAssertExpr(pos, ir.ODYNAMICDOTTYPE, x, typ.RType) assert.SrcRType = srcRType assert.ITab = typ.ITab return typed(typ.Type(), assert) } return typecheck.Expr(ir.NewTypeAssertExpr(pos, x, typ.Type())) case exprUnaryOp: op := r.op() pos := r.pos() x := r.expr() switch op { case ir.OADDR: return typecheck.Expr(typecheck.NodAddrAt(pos, x)) case ir.ODEREF: return typecheck.Expr(ir.NewStarExpr(pos, x)) } return typecheck.Expr(ir.NewUnaryExpr(pos, op, x)) case exprBinaryOp: op := r.op() x := r.expr() pos := r.pos() y := r.expr() switch op { case ir.OANDAND, ir.OOROR: return typecheck.Expr(ir.NewLogicalExpr(pos, op, x, y)) } return typecheck.Expr(ir.NewBinaryExpr(pos, op, x, y)) case exprRecv: x := r.expr() pos := r.pos() for i, n := 0, r.Len(); i < n; i++ { x = Implicit(DotField(pos, x, r.Len())) } if r.Bool() { // needs deref x = Implicit(Deref(pos, x.Type().Elem(), x)) } else if r.Bool() { // needs addr x = Implicit(Addr(pos, x)) } return x case exprCall: var fun ir.Node var args ir.Nodes if r.Bool() { // method call recv := r.expr() _, method, dictPtr := r.methodExpr() if recv.Type().IsInterface() && method.Op() == ir.OMETHEXPR { method := method.(*ir.SelectorExpr) // The compiler backend (e.g., devirtualization) handle // OCALLINTER/ODOTINTER better than OCALLFUNC/OMETHEXPR for // interface calls, so we prefer to continue constructing // calls that way where possible. // // There are also corner cases where semantically it's perhaps // significant; e.g., fixedbugs/issue15975.go, #38634, #52025. fun = typecheck.Callee(ir.NewSelectorExpr(method.Pos(), ir.OXDOT, recv, method.Sel)) } else { if recv.Type().IsInterface() { // N.B., this happens currently for typeparam/issue51521.go // and typeparam/typeswitch3.go. if base.Flag.LowerM > 0 { base.WarnfAt(method.Pos(), "imprecise interface call") } } fun = method args.Append(recv) } if dictPtr != nil { args.Append(dictPtr) } } else if r.Bool() { // call to instanced function pos := r.pos() _, shapedFn, dictPtr := r.funcInst(pos) fun = shapedFn args.Append(dictPtr) } else { fun = r.expr() } pos := r.pos() args.Append(r.multiExpr()...) dots := r.Bool() n := typecheck.Call(pos, fun, args, dots) switch n.Op() { case ir.OAPPEND: n := n.(*ir.CallExpr) n.RType = r.rtype(pos) // For append(a, b...), we don't need the implicit conversion. The typechecker already // ensured that a and b are both slices with the same base type, or []byte and string. if n.IsDDD { if conv, ok := n.Args[1].(*ir.ConvExpr); ok && conv.Op() == ir.OCONVNOP && conv.Implicit() { n.Args[1] = conv.X } } case ir.OCOPY: n := n.(*ir.BinaryExpr) n.RType = r.rtype(pos) case ir.ODELETE: n := n.(*ir.CallExpr) n.RType = r.rtype(pos) case ir.OUNSAFESLICE: n := n.(*ir.BinaryExpr) n.RType = r.rtype(pos) } return n case exprMake: pos := r.pos() typ := r.exprType() extra := r.exprs() n := typecheck.Expr(ir.NewCallExpr(pos, ir.OMAKE, nil, append([]ir.Node{typ}, extra...))).(*ir.MakeExpr) n.RType = r.rtype(pos) return n case exprNew: pos := r.pos() typ := r.exprType() return typecheck.Expr(ir.NewUnaryExpr(pos, ir.ONEW, typ)) case exprReshape: typ := r.typ() x := r.expr() if types.IdenticalStrict(x.Type(), typ) { return x } // Comparison expressions are constructed as "untyped bool" still. // // TODO(mdempsky): It should be safe to reshape them here too, but // maybe it's better to construct them with the proper type // instead. if x.Type() == types.UntypedBool && typ.IsBoolean() { return x } base.AssertfAt(x.Type().HasShape() || typ.HasShape(), x.Pos(), "%L and %v are not shape types", x, typ) base.AssertfAt(types.Identical(x.Type(), typ), x.Pos(), "%L is not shape-identical to %v", x, typ) // We use ir.HasUniquePos here as a check that x only appears once // in the AST, so it's okay for us to call SetType without // breaking any other uses of it. // // Notably, any ONAMEs should already have the exactly right shape // type and been caught by types.IdenticalStrict above. base.AssertfAt(ir.HasUniquePos(x), x.Pos(), "cannot call SetType(%v) on %L", typ, x) if base.Debug.Reshape != 0 { base.WarnfAt(x.Pos(), "reshaping %L to %v", x, typ) } x.SetType(typ) return x case exprConvert: implicit := r.Bool() typ := r.typ() pos := r.pos() typeWord, srcRType := r.convRTTI(pos) dstTypeParam := r.Bool() x := r.expr() // TODO(mdempsky): Stop constructing expressions of untyped type. x = typecheck.DefaultLit(x, typ) if op, why := typecheck.Convertop(x.Op() == ir.OLITERAL, x.Type(), typ); op == ir.OXXX { // types2 ensured that x is convertable to typ under standard Go // semantics, but cmd/compile also disallows some conversions // involving //go:notinheap. // // TODO(mdempsky): This can be removed after #46731 is implemented. base.ErrorfAt(pos, "cannot convert %L to type %v%v", x, typ, why) base.ErrorExit() // harsh, but prevents constructing invalid IR } ce := ir.NewConvExpr(pos, ir.OCONV, typ, x) ce.TypeWord, ce.SrcRType = typeWord, srcRType if implicit { ce.SetImplicit(true) } n := typecheck.Expr(ce) // Conversions between non-identical, non-empty interfaces always // requires a runtime call, even if they have identical underlying // interfaces. This is because we create separate itab instances // for each unique interface type, not merely each unique // interface shape. // // However, due to shape types, typecheck.Expr might mistakenly // think a conversion between two non-empty interfaces are // identical and set ir.OCONVNOP, instead of ir.OCONVIFACE. To // ensure we update the itab field appropriately, we force it to // ir.OCONVIFACE instead when shape types are involved. // // TODO(mdempsky): Are there other places we might get this wrong? // Should this be moved down into typecheck.{Assign,Convert}op? // This would be a non-issue if itabs were unique for each // *underlying* interface type instead. if n, ok := n.(*ir.ConvExpr); ok && n.Op() == ir.OCONVNOP && n.Type().IsInterface() && !n.Type().IsEmptyInterface() && (n.Type().HasShape() || n.X.Type().HasShape()) { n.SetOp(ir.OCONVIFACE) } // spec: "If the type is a type parameter, the constant is converted // into a non-constant value of the type parameter." if dstTypeParam && ir.IsConstNode(n) { // Wrap in an OCONVNOP node to ensure result is non-constant. n = Implicit(ir.NewConvExpr(pos, ir.OCONVNOP, n.Type(), n)) n.SetTypecheck(1) } return n } } // funcInst reads an instantiated function reference, and returns // three (possibly nil) expressions related to it: // // baseFn is always non-nil: it's either a function of the appropriate // type already, or it has an extra dictionary parameter as the first // parameter. // // If dictPtr is non-nil, then it's a dictionary argument that must be // passed as the first argument to baseFn. // // If wrapperFn is non-nil, then it's either the same as baseFn (if // dictPtr is nil), or it's semantically equivalent to currying baseFn // to pass dictPtr. (wrapperFn is nil when dictPtr is an expression // that needs to be computed dynamically.) // // For callers that are creating a call to the returned function, it's // best to emit a call to baseFn, and include dictPtr in the arguments // list as appropriate. // // For callers that want to return the function without invoking it, // they may return wrapperFn if it's non-nil; but otherwise, they need // to create their own wrapper. func (r *reader) funcInst(pos src.XPos) (wrapperFn, baseFn, dictPtr ir.Node) { // Like in methodExpr, I'm pretty sure this isn't needed. var implicits []*types.Type if r.dict != nil { implicits = r.dict.targs } if r.Bool() { // dynamic subdictionary idx := r.Len() info := r.dict.subdicts[idx] explicits := r.p.typListIdx(info.explicits, r.dict) baseFn = r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) // TODO(mdempsky): Is there a more robust way to get the // dictionary pointer type here? dictPtrType := baseFn.Type().Params().Field(0).Type dictPtr = typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, dictPtrType, r.dictWord(pos, r.dict.subdictsOffset()+idx))) return } info := r.objInfo() explicits := r.p.typListIdx(info.explicits, r.dict) wrapperFn = r.p.objIdx(info.idx, implicits, explicits, false).(*ir.Name) baseFn = r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) dictName := r.p.objDictName(info.idx, implicits, explicits) dictPtr = typecheck.Expr(ir.NewAddrExpr(pos, dictName)) return } func (pr *pkgReader) objDictName(idx pkgbits.Index, implicits, explicits []*types.Type) *ir.Name { rname := pr.newReader(pkgbits.RelocName, idx, pkgbits.SyncObject1) _, sym := rname.qualifiedIdent() tag := pkgbits.CodeObj(rname.Code(pkgbits.SyncCodeObj)) if tag == pkgbits.ObjStub { assert(!sym.IsBlank()) if pri, ok := objReader[sym]; ok { return pri.pr.objDictName(pri.idx, nil, explicits) } base.Fatalf("unresolved stub: %v", sym) } dict := pr.objDictIdx(sym, idx, implicits, explicits, false) return pr.dictNameOf(dict) } // curry returns a function literal that calls fun with arg0 and // (optionally) arg1, accepting additional arguments to the function // literal as necessary to satisfy fun's signature. // // If nilCheck is true and arg0 is an interface value, then it's // checked to be non-nil as an initial step at the point of evaluating // the function literal itself. func (r *reader) curry(pos src.XPos, ifaceHack bool, fun ir.Node, arg0, arg1 ir.Node) ir.Node { var captured ir.Nodes captured.Append(fun, arg0) if arg1 != nil { captured.Append(arg1) } params, results := syntheticSig(fun.Type()) params = params[len(captured)-1:] // skip curried parameters typ := types.NewSignature(types.NoPkg, nil, nil, params, results) addBody := func(pos src.XPos, r *reader, captured []ir.Node) { recvs, params := r.syntheticArgs(pos) assert(len(recvs) == 0) fun := captured[0] var args ir.Nodes args.Append(captured[1:]...) args.Append(params...) r.syntheticTailCall(pos, fun, args) } return r.syntheticClosure(pos, typ, ifaceHack, captured, addBody) } // methodExprWrap returns a function literal that changes method's // first parameter's type to recv, and uses implicits/deref/addr to // select the appropriate receiver parameter to pass to method. func (r *reader) methodExprWrap(pos src.XPos, recv *types.Type, implicits []int, deref, addr bool, method, dictPtr ir.Node) ir.Node { var captured ir.Nodes captured.Append(method) params, results := syntheticSig(method.Type()) // Change first parameter to recv. params[0].Type = recv // If we have a dictionary pointer argument to pass, then omit the // underlying method expression's dictionary parameter from the // returned signature too. if dictPtr != nil { captured.Append(dictPtr) params = append(params[:1], params[2:]...) } typ := types.NewSignature(types.NoPkg, nil, nil, params, results) addBody := func(pos src.XPos, r *reader, captured []ir.Node) { recvs, args := r.syntheticArgs(pos) assert(len(recvs) == 0) fn := captured[0] // Rewrite first argument based on implicits/deref/addr. { arg := args[0] for _, ix := range implicits { arg = Implicit(DotField(pos, arg, ix)) } if deref { arg = Implicit(Deref(pos, arg.Type().Elem(), arg)) } else if addr { arg = Implicit(Addr(pos, arg)) } args[0] = arg } // Insert dictionary argument, if provided. if dictPtr != nil { newArgs := make([]ir.Node, len(args)+1) newArgs[0] = args[0] newArgs[1] = captured[1] copy(newArgs[2:], args[1:]) args = newArgs } r.syntheticTailCall(pos, fn, args) } return r.syntheticClosure(pos, typ, false, captured, addBody) } // syntheticClosure constructs a synthetic function literal for // currying dictionary arguments. pos is the position used for the // closure. typ is the function literal's signature type. // // captures is a list of expressions that need to be evaluated at the // point of function literal evaluation and captured by the function // literal. If ifaceHack is true and captures[1] is an interface type, // it's checked to be non-nil after evaluation. // // addBody is a callback function to populate the function body. The // list of captured values passed back has the captured variables for // use within the function literal, corresponding to the expressions // in captures. func (r *reader) syntheticClosure(pos src.XPos, typ *types.Type, ifaceHack bool, captures ir.Nodes, addBody func(pos src.XPos, r *reader, captured []ir.Node)) ir.Node { // isSafe reports whether n is an expression that we can safely // defer to evaluating inside the closure instead, to avoid storing // them into the closure. // // In practice this is always (and only) the wrappee function. isSafe := func(n ir.Node) bool { if n.Op() == ir.ONAME && n.(*ir.Name).Class == ir.PFUNC { return true } if n.Op() == ir.OMETHEXPR { return true } return false } fn := ir.NewClosureFunc(pos, r.curfn != nil) fn.SetWrapper(true) clo := fn.OClosure ir.NameClosure(clo, r.curfn) setType(fn.Nname, typ) typecheck.Func(fn) setType(clo, fn.Type()) var init ir.Nodes for i, n := range captures { if isSafe(n) { continue // skip capture; can reference directly } tmp := r.tempCopy(pos, n, &init) ir.NewClosureVar(pos, fn, tmp) // We need to nil check interface receivers at the point of method // value evaluation, ugh. if ifaceHack && i == 1 && n.Type().IsInterface() { check := ir.NewUnaryExpr(pos, ir.OCHECKNIL, ir.NewUnaryExpr(pos, ir.OITAB, tmp)) init.Append(typecheck.Stmt(check)) } } pri := pkgReaderIndex{synthetic: func(pos src.XPos, r *reader) { captured := make([]ir.Node, len(captures)) next := 0 for i, n := range captures { if isSafe(n) { captured[i] = n } else { captured[i] = r.closureVars[next] next++ } } assert(next == len(r.closureVars)) addBody(pos, r, captured) }} bodyReader[fn] = pri pri.funcBody(fn) // TODO(mdempsky): Remove hard-coding of typecheck.Target. return ir.InitExpr(init, ir.UseClosure(clo, typecheck.Target)) } // syntheticSig duplicates and returns the params and results lists // for sig, but renaming anonymous parameters so they can be assigned // ir.Names. func syntheticSig(sig *types.Type) (params, results []*types.Field) { clone := func(params []*types.Field) []*types.Field { res := make([]*types.Field, len(params)) for i, param := range params { sym := param.Sym if sym == nil || sym.Name == "_" { sym = typecheck.LookupNum(".anon", i) } // TODO(mdempsky): It would be nice to preserve the original // parameter positions here instead, but at least // typecheck.NewMethodType replaces them with base.Pos, making // them useless. Worse, the positions copied from base.Pos may // have inlining contexts, which we definitely don't want here // (e.g., #54625). res[i] = types.NewField(base.AutogeneratedPos, sym, param.Type) res[i].SetIsDDD(param.IsDDD()) } return res } return clone(sig.Params().FieldSlice()), clone(sig.Results().FieldSlice()) } func (r *reader) optExpr() ir.Node { if r.Bool() { return r.expr() } return nil } // methodExpr reads a method expression reference, and returns three // (possibly nil) expressions related to it: // // baseFn is always non-nil: it's either a function of the appropriate // type already, or it has an extra dictionary parameter as the second // parameter (i.e., immediately after the promoted receiver // parameter). // // If dictPtr is non-nil, then it's a dictionary argument that must be // passed as the second argument to baseFn. // // If wrapperFn is non-nil, then it's either the same as baseFn (if // dictPtr is nil), or it's semantically equivalent to currying baseFn // to pass dictPtr. (wrapperFn is nil when dictPtr is an expression // that needs to be computed dynamically.) // // For callers that are creating a call to the returned method, it's // best to emit a call to baseFn, and include dictPtr in the arguments // list as appropriate. // // For callers that want to return a method expression without // invoking it, they may return wrapperFn if it's non-nil; but // otherwise, they need to create their own wrapper. func (r *reader) methodExpr() (wrapperFn, baseFn, dictPtr ir.Node) { recv := r.typ() sig0 := r.typ() pos := r.pos() _, sym := r.selector() // Signature type to return (i.e., recv prepended to the method's // normal parameters list). sig := typecheck.NewMethodType(sig0, recv) if r.Bool() { // type parameter method expression idx := r.Len() word := r.dictWord(pos, r.dict.typeParamMethodExprsOffset()+idx) // TODO(mdempsky): If the type parameter was instantiated with an // interface type (i.e., embed.IsInterface()), then we could // return the OMETHEXPR instead and save an indirection. // We wrote the method expression's entry point PC into the // dictionary, but for Go `func` values we need to return a // closure (i.e., pointer to a structure with the PC as the first // field). Because method expressions don't have any closure // variables, we pun the dictionary entry as the closure struct. fn := typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, sig, ir.NewAddrExpr(pos, word))) return fn, fn, nil } // TODO(mdempsky): I'm pretty sure this isn't needed: implicits is // only relevant to locally defined types, but they can't have // (non-promoted) methods. var implicits []*types.Type if r.dict != nil { implicits = r.dict.targs } if r.Bool() { // dynamic subdictionary idx := r.Len() info := r.dict.subdicts[idx] explicits := r.p.typListIdx(info.explicits, r.dict) shapedObj := r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) shapedFn := shapedMethodExpr(pos, shapedObj, sym) // TODO(mdempsky): Is there a more robust way to get the // dictionary pointer type here? dictPtrType := shapedFn.Type().Params().Field(1).Type dictPtr := typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, dictPtrType, r.dictWord(pos, r.dict.subdictsOffset()+idx))) return nil, shapedFn, dictPtr } if r.Bool() { // static dictionary info := r.objInfo() explicits := r.p.typListIdx(info.explicits, r.dict) shapedObj := r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) shapedFn := shapedMethodExpr(pos, shapedObj, sym) dict := r.p.objDictName(info.idx, implicits, explicits) dictPtr := typecheck.Expr(ir.NewAddrExpr(pos, dict)) // Check that dictPtr matches shapedFn's dictionary parameter. if !types.Identical(dictPtr.Type(), shapedFn.Type().Params().Field(1).Type) { base.FatalfAt(pos, "dict %L, but shaped method %L", dict, shapedFn) } // For statically known instantiations, we can take advantage of // the stenciled wrapper. base.AssertfAt(!recv.HasShape(), pos, "shaped receiver %v", recv) wrapperFn := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), sym)).(*ir.SelectorExpr) base.AssertfAt(types.Identical(sig, wrapperFn.Type()), pos, "wrapper %L does not have type %v", wrapperFn, sig) return wrapperFn, shapedFn, dictPtr } // Simple method expression; no dictionary needed. base.AssertfAt(!recv.HasShape() || recv.IsInterface(), pos, "shaped receiver %v", recv) fn := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), sym)).(*ir.SelectorExpr) return fn, fn, nil } // shapedMethodExpr returns the specified method on the given shaped // type. func shapedMethodExpr(pos src.XPos, obj *ir.Name, sym *types.Sym) *ir.SelectorExpr { assert(obj.Op() == ir.OTYPE) typ := obj.Type() assert(typ.HasShape()) method := func() *types.Field { for _, method := range typ.Methods().Slice() { if method.Sym == sym { return method } } base.FatalfAt(pos, "failed to find method %v in shaped type %v", sym, typ) panic("unreachable") }() // Construct an OMETHEXPR node. recv := method.Type.Recv().Type return typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), sym)).(*ir.SelectorExpr) } func (r *reader) multiExpr() []ir.Node { r.Sync(pkgbits.SyncMultiExpr) if r.Bool() { // N:1 pos := r.pos() expr := r.expr() results := make([]ir.Node, r.Len()) as := ir.NewAssignListStmt(pos, ir.OAS2, nil, []ir.Node{expr}) as.Def = true for i := range results { tmp := r.temp(pos, r.typ()) as.PtrInit().Append(ir.NewDecl(pos, ir.ODCL, tmp)) as.Lhs.Append(tmp) res := ir.Node(tmp) if r.Bool() { n := ir.NewConvExpr(pos, ir.OCONV, r.typ(), res) n.TypeWord, n.SrcRType = r.convRTTI(pos) n.SetImplicit(true) res = typecheck.Expr(n) } results[i] = res } // TODO(mdempsky): Could use ir.InlinedCallExpr instead? results[0] = ir.InitExpr([]ir.Node{typecheck.Stmt(as)}, results[0]) return results } // N:N exprs := make([]ir.Node, r.Len()) if len(exprs) == 0 { return nil } for i := range exprs { exprs[i] = r.expr() } return exprs } // temp returns a new autotemp of the specified type. func (r *reader) temp(pos src.XPos, typ *types.Type) *ir.Name { // See typecheck.typecheckargs. curfn := r.curfn if curfn == nil { curfn = typecheck.InitTodoFunc } return typecheck.TempAt(pos, curfn, typ) } // tempCopy declares and returns a new autotemp initialized to the // value of expr. func (r *reader) tempCopy(pos src.XPos, expr ir.Node, init *ir.Nodes) *ir.Name { if r.curfn == nil { // Escape analysis doesn't know how to handle package-scope // function literals with free variables (i.e., that capture // temporary variables added to typecheck.InitTodoFunc). // // stencil.go works around this limitation by spilling values to // global variables instead, but that causes the value to stay // alive indefinitely; see go.dev/issue/54343. // // This code path (which implements the same workaround) isn't // actually needed by unified IR, because it creates uses normal // OMETHEXPR/OMETHVALUE nodes when statically-known instantiated // types are used. But it's kept around for now because it's handy // for testing that the generic fallback paths work correctly. base.Fatalf("tempCopy called at package scope") tmp := staticinit.StaticName(expr.Type()) assign := ir.NewAssignStmt(pos, tmp, expr) assign.Def = true tmp.Defn = assign typecheck.Target.Decls = append(typecheck.Target.Decls, typecheck.Stmt(assign)) return tmp } tmp := r.temp(pos, expr.Type()) init.Append(typecheck.Stmt(ir.NewDecl(pos, ir.ODCL, tmp))) assign := ir.NewAssignStmt(pos, tmp, expr) assign.Def = true init.Append(typecheck.Stmt(ir.NewAssignStmt(pos, tmp, expr))) tmp.Defn = assign return tmp } func (r *reader) compLit() ir.Node { r.Sync(pkgbits.SyncCompLit) pos := r.pos() typ0 := r.typ() typ := typ0 if typ.IsPtr() { typ = typ.Elem() } if typ.Kind() == types.TFORW { base.FatalfAt(pos, "unresolved composite literal type: %v", typ) } var rtype ir.Node if typ.IsMap() { rtype = r.rtype(pos) } isStruct := typ.Kind() == types.TSTRUCT elems := make([]ir.Node, r.Len()) for i := range elems { elemp := &elems[i] if isStruct { sk := ir.NewStructKeyExpr(r.pos(), typ.Field(r.Len()), nil) *elemp, elemp = sk, &sk.Value } else if r.Bool() { kv := ir.NewKeyExpr(r.pos(), r.expr(), nil) *elemp, elemp = kv, &kv.Value } *elemp = wrapName(r.pos(), r.expr()) } lit := typecheck.Expr(ir.NewCompLitExpr(pos, ir.OCOMPLIT, typ, elems)) if rtype != nil { lit := lit.(*ir.CompLitExpr) lit.RType = rtype } if typ0.IsPtr() { lit = typecheck.Expr(typecheck.NodAddrAt(pos, lit)) lit.SetType(typ0) } return lit } func wrapName(pos src.XPos, x ir.Node) ir.Node { // These nodes do not carry line numbers. // Introduce a wrapper node to give them the correct line. switch ir.Orig(x).Op() { case ir.OTYPE, ir.OLITERAL: if x.Sym() == nil { break } fallthrough case ir.ONAME, ir.ONONAME, ir.ONIL: p := ir.NewParenExpr(pos, x) p.SetImplicit(true) return p } return x } func (r *reader) funcLit() ir.Node { r.Sync(pkgbits.SyncFuncLit) // The underlying function declaration (including its parameters' // positions, if any) need to remain the original, uninlined // positions. This is because we track inlining-context on nodes so // we can synthesize the extra implied stack frames dynamically when // generating tracebacks, whereas those stack frames don't make // sense *within* the function literal. (Any necessary inlining // adjustments will have been applied to the call expression // instead.) // // This is subtle, and getting it wrong leads to cycles in the // inlining tree, which lead to infinite loops during stack // unwinding (#46234, #54625). // // Note that we *do* want the inline-adjusted position for the // OCLOSURE node, because that position represents where any heap // allocation of the closure is credited (#49171). r.suppressInlPos++ pos := r.pos() xtype2 := r.signature(types.LocalPkg, nil) r.suppressInlPos-- fn := ir.NewClosureFunc(pos, r.curfn != nil) clo := fn.OClosure clo.SetPos(r.inlPos(pos)) // see comment above ir.NameClosure(clo, r.curfn) setType(fn.Nname, xtype2) typecheck.Func(fn) setType(clo, fn.Type()) fn.ClosureVars = make([]*ir.Name, 0, r.Len()) for len(fn.ClosureVars) < cap(fn.ClosureVars) { ir.NewClosureVar(r.pos(), fn, r.useLocal()) } if param := r.dictParam; param != nil { // If we have a dictionary parameter, capture it too. For // simplicity, we capture it last and unconditionally. ir.NewClosureVar(param.Pos(), fn, param) } r.addBody(fn, nil) // TODO(mdempsky): Remove hard-coding of typecheck.Target. return ir.UseClosure(clo, typecheck.Target) } func (r *reader) exprList() []ir.Node { r.Sync(pkgbits.SyncExprList) return r.exprs() } func (r *reader) exprs() []ir.Node { r.Sync(pkgbits.SyncExprs) nodes := make([]ir.Node, r.Len()) if len(nodes) == 0 { return nil // TODO(mdempsky): Unclear if this matters. } for i := range nodes { nodes[i] = r.expr() } return nodes } // dictWord returns an expression to return the specified // uintptr-typed word from the dictionary parameter. func (r *reader) dictWord(pos src.XPos, idx int) ir.Node { base.AssertfAt(r.dictParam != nil, pos, "expected dictParam in %v", r.curfn) return typecheck.Expr(ir.NewIndexExpr(pos, r.dictParam, ir.NewBasicLit(pos, constant.MakeInt64(int64(idx))))) } // rttiWord is like dictWord, but converts it to *byte (the type used // internally to represent *runtime._type and *runtime.itab). func (r *reader) rttiWord(pos src.XPos, idx int) ir.Node { return typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, types.NewPtr(types.Types[types.TUINT8]), r.dictWord(pos, idx))) } // rtype reads a type reference from the element bitstream, and // returns an expression of type *runtime._type representing that // type. func (r *reader) rtype(pos src.XPos) ir.Node { _, rtype := r.rtype0(pos) return rtype } func (r *reader) rtype0(pos src.XPos) (typ *types.Type, rtype ir.Node) { r.Sync(pkgbits.SyncRType) if r.Bool() { // derived type idx := r.Len() info := r.dict.rtypes[idx] typ = r.p.typIdx(info, r.dict, true) rtype = r.rttiWord(pos, r.dict.rtypesOffset()+idx) return } typ = r.typ() rtype = reflectdata.TypePtrAt(pos, typ) return } // varDictIndex populates name.DictIndex if name is a derived type. func (r *reader) varDictIndex(name *ir.Name) { if r.Bool() { idx := 1 + r.dict.rtypesOffset() + r.Len() if int(uint16(idx)) != idx { base.FatalfAt(name.Pos(), "DictIndex overflow for %v: %v", name, idx) } name.DictIndex = uint16(idx) } } func (r *reader) itab(pos src.XPos) (typ *types.Type, typRType ir.Node, iface *types.Type, ifaceRType ir.Node, itab ir.Node) { if r.Bool() { // derived types idx := r.Len() info := r.dict.itabs[idx] typ = r.p.typIdx(info.typ, r.dict, true) typRType = r.rttiWord(pos, r.dict.itabsOffset()+3*idx) iface = r.p.typIdx(info.iface, r.dict, true) ifaceRType = r.rttiWord(pos, r.dict.itabsOffset()+3*idx+1) itab = r.rttiWord(pos, r.dict.itabsOffset()+3*idx+2) return } typ = r.typ() iface = r.typ() if iface.IsInterface() { typRType = reflectdata.TypePtrAt(pos, typ) ifaceRType = reflectdata.TypePtrAt(pos, iface) if !typ.IsInterface() && !iface.IsEmptyInterface() { lsym := reflectdata.ITabLsym(typ, iface) itab = typecheck.LinksymAddr(pos, lsym, types.Types[types.TUINT8]) } } return } // convRTTI returns expressions appropriate for populating an // ir.ConvExpr's TypeWord and SrcRType fields, respectively. func (r *reader) convRTTI(pos src.XPos) (typeWord, srcRType ir.Node) { r.Sync(pkgbits.SyncConvRTTI) src, srcRType0, dst, dstRType, itab := r.itab(pos) if !dst.IsInterface() { return } // See reflectdata.ConvIfaceTypeWord. switch { case dst.IsEmptyInterface(): if !src.IsInterface() { typeWord = srcRType0 // direct eface construction } case !src.IsInterface(): typeWord = itab // direct iface construction default: typeWord = dstRType // convI2I } // See reflectdata.ConvIfaceSrcRType. if !src.IsInterface() { srcRType = srcRType0 } return } func (r *reader) exprType() ir.Node { r.Sync(pkgbits.SyncExprType) pos := r.pos() var typ *types.Type var rtype, itab ir.Node if r.Bool() { typ, rtype, _, _, itab = r.itab(pos) if typ.IsInterface() { itab = nil } else { rtype = nil // TODO(mdempsky): Leave set? } } else { typ, rtype = r.rtype0(pos) if !r.Bool() { // not derived // TODO(mdempsky): ir.TypeNode should probably return a typecheck'd node. n := ir.TypeNode(typ) n.SetTypecheck(1) return n } } dt := ir.NewDynamicType(pos, rtype) dt.ITab = itab return typed(typ, dt) } func (r *reader) op() ir.Op { r.Sync(pkgbits.SyncOp) return ir.Op(r.Len()) } // @@@ Package initialization func (r *reader) pkgInit(self *types.Pkg, target *ir.Package) { cgoPragmas := make([][]string, r.Len()) for i := range cgoPragmas { cgoPragmas[i] = r.Strings() } target.CgoPragmas = cgoPragmas r.pkgDecls(target) r.Sync(pkgbits.SyncEOF) } func (r *reader) pkgDecls(target *ir.Package) { r.Sync(pkgbits.SyncDecls) for { switch code := codeDecl(r.Code(pkgbits.SyncDecl)); code { default: panic(fmt.Sprintf("unhandled decl: %v", code)) case declEnd: return case declFunc: names := r.pkgObjs(target) assert(len(names) == 1) target.Decls = append(target.Decls, names[0].Func) case declMethod: typ := r.typ() _, sym := r.selector() method := typecheck.Lookdot1(nil, sym, typ, typ.Methods(), 0) target.Decls = append(target.Decls, method.Nname.(*ir.Name).Func) case declVar: pos := r.pos() names := r.pkgObjs(target) values := r.exprList() if len(names) > 1 && len(values) == 1 { as := ir.NewAssignListStmt(pos, ir.OAS2, nil, values) for _, name := range names { as.Lhs.Append(name) name.Defn = as } target.Decls = append(target.Decls, as) } else { for i, name := range names { as := ir.NewAssignStmt(pos, name, nil) if i < len(values) { as.Y = values[i] } name.Defn = as target.Decls = append(target.Decls, as) } } if n := r.Len(); n > 0 { assert(len(names) == 1) embeds := make([]ir.Embed, n) for i := range embeds { embeds[i] = ir.Embed{Pos: r.pos(), Patterns: r.Strings()} } names[0].Embed = &embeds target.Embeds = append(target.Embeds, names[0]) } case declOther: r.pkgObjs(target) } } } func (r *reader) pkgObjs(target *ir.Package) []*ir.Name { r.Sync(pkgbits.SyncDeclNames) nodes := make([]*ir.Name, r.Len()) for i := range nodes { r.Sync(pkgbits.SyncDeclName) name := r.obj().(*ir.Name) nodes[i] = name sym := name.Sym() if sym.IsBlank() { continue } switch name.Class { default: base.FatalfAt(name.Pos(), "unexpected class: %v", name.Class) case ir.PEXTERN: target.Externs = append(target.Externs, name) case ir.PFUNC: assert(name.Type().Recv() == nil) // TODO(mdempsky): Cleaner way to recognize init? if strings.HasPrefix(sym.Name, "init.") { target.Inits = append(target.Inits, name.Func) } } if types.IsExported(sym.Name) { assert(!sym.OnExportList()) target.Exports = append(target.Exports, name) sym.SetOnExportList(true) } if base.Flag.AsmHdr != "" { assert(!sym.Asm()) target.Asms = append(target.Asms, name) sym.SetAsm(true) } } return nodes } // @@@ Inlining var inlgen = 0 // InlineCall implements inline.NewInline by re-reading the function // body from its Unified IR export data. func InlineCall(call *ir.CallExpr, fn *ir.Func, inlIndex int) *ir.InlinedCallExpr { // TODO(mdempsky): Turn callerfn into an explicit parameter. callerfn := ir.CurFunc pri, ok := bodyReaderFor(fn) if !ok { // TODO(mdempsky): Reconsider this diagnostic's wording, if it's // to be included in Go 1.20. if base.Flag.LowerM != 0 { base.WarnfAt(call.Pos(), "cannot inline call to %v: missing inline body", fn) } return nil } if fn.Inl.Body == nil { expandInline(fn, pri) } r := pri.asReader(pkgbits.RelocBody, pkgbits.SyncFuncBody) // TODO(mdempsky): This still feels clumsy. Can we do better? tmpfn := ir.NewFunc(fn.Pos()) tmpfn.Nname = ir.NewNameAt(fn.Nname.Pos(), callerfn.Sym()) tmpfn.Closgen = callerfn.Closgen defer func() { callerfn.Closgen = tmpfn.Closgen }() setType(tmpfn.Nname, fn.Type()) r.curfn = tmpfn r.inlCaller = callerfn r.inlCall = call r.inlFunc = fn r.inlTreeIndex = inlIndex r.inlPosBases = make(map[*src.PosBase]*src.PosBase) r.closureVars = make([]*ir.Name, len(r.inlFunc.ClosureVars)) for i, cv := range r.inlFunc.ClosureVars { r.closureVars[i] = cv.Outer } if len(r.closureVars) != 0 && r.hasTypeParams() { r.dictParam = r.closureVars[len(r.closureVars)-1] // dictParam is last; see reader.funcLit } r.funcargs(fn) r.delayResults = fn.Inl.CanDelayResults r.retlabel = typecheck.AutoLabel(".i") inlgen++ init := ir.TakeInit(call) // For normal function calls, the function callee expression // may contain side effects. Make sure to preserve these, // if necessary (#42703). if call.Op() == ir.OCALLFUNC { inline.CalleeEffects(&init, call.X) } var args ir.Nodes if call.Op() == ir.OCALLMETH { base.FatalfAt(call.Pos(), "OCALLMETH missed by typecheck") } args.Append(call.Args...) // Create assignment to declare and initialize inlvars. as2 := ir.NewAssignListStmt(call.Pos(), ir.OAS2, r.inlvars, args) as2.Def = true var as2init ir.Nodes for _, name := range r.inlvars { if ir.IsBlank(name) { continue } // TODO(mdempsky): Use inlined position of name.Pos() instead? name := name.(*ir.Name) as2init.Append(ir.NewDecl(call.Pos(), ir.ODCL, name)) name.Defn = as2 } as2.SetInit(as2init) init.Append(typecheck.Stmt(as2)) if !r.delayResults { // If not delaying retvars, declare and zero initialize the // result variables now. for _, name := range r.retvars { // TODO(mdempsky): Use inlined position of name.Pos() instead? name := name.(*ir.Name) init.Append(ir.NewDecl(call.Pos(), ir.ODCL, name)) ras := ir.NewAssignStmt(call.Pos(), name, nil) init.Append(typecheck.Stmt(ras)) } } // Add an inline mark just before the inlined body. // This mark is inline in the code so that it's a reasonable spot // to put a breakpoint. Not sure if that's really necessary or not // (in which case it could go at the end of the function instead). // Note issue 28603. init.Append(ir.NewInlineMarkStmt(call.Pos().WithIsStmt(), int64(r.inlTreeIndex))) nparams := len(r.curfn.Dcl) ir.WithFunc(r.curfn, func() { if !r.syntheticBody(call.Pos()) { assert(r.Bool()) // have body r.curfn.Body = r.stmts() r.curfn.Endlineno = r.pos() } // TODO(mdempsky): This shouldn't be necessary. Inlining might // read in new function/method declarations, which could // potentially be recursively inlined themselves; but we shouldn't // need to read in the non-inlined bodies for the declarations // themselves. But currently it's an easy fix to #50552. readBodies(typecheck.Target) deadcode.Func(r.curfn) // Replace any "return" statements within the function body. var edit func(ir.Node) ir.Node edit = func(n ir.Node) ir.Node { if ret, ok := n.(*ir.ReturnStmt); ok { n = typecheck.Stmt(r.inlReturn(ret)) } ir.EditChildren(n, edit) return n } edit(r.curfn) }) body := ir.Nodes(r.curfn.Body) // Quirkish: We need to eagerly prune variables added during // inlining, but removed by deadcode.FuncBody above. Unused // variables will get removed during stack frame layout anyway, but // len(fn.Dcl) ends up influencing things like autotmp naming. used := usedLocals(body) for i, name := range r.curfn.Dcl { if i < nparams || used.Has(name) { name.Curfn = callerfn callerfn.Dcl = append(callerfn.Dcl, name) // Quirkish. TODO(mdempsky): Document why. if name.AutoTemp() { name.SetEsc(ir.EscUnknown) if base.Flag.GenDwarfInl != 0 { name.SetInlLocal(true) } else { name.SetPos(r.inlCall.Pos()) } } } } body.Append(ir.NewLabelStmt(call.Pos(), r.retlabel)) res := ir.NewInlinedCallExpr(call.Pos(), body, append([]ir.Node(nil), r.retvars...)) res.SetInit(init) res.SetType(call.Type()) res.SetTypecheck(1) // Inlining shouldn't add any functions to todoBodies. assert(len(todoBodies) == 0) return res } // inlReturn returns a statement that can substitute for the given // return statement when inlining. func (r *reader) inlReturn(ret *ir.ReturnStmt) *ir.BlockStmt { pos := r.inlCall.Pos() block := ir.TakeInit(ret) if results := ret.Results; len(results) != 0 { assert(len(r.retvars) == len(results)) as2 := ir.NewAssignListStmt(pos, ir.OAS2, append([]ir.Node(nil), r.retvars...), ret.Results) if r.delayResults { for _, name := range r.retvars { // TODO(mdempsky): Use inlined position of name.Pos() instead? name := name.(*ir.Name) block.Append(ir.NewDecl(pos, ir.ODCL, name)) name.Defn = as2 } } block.Append(as2) } block.Append(ir.NewBranchStmt(pos, ir.OGOTO, r.retlabel)) return ir.NewBlockStmt(pos, block) } // expandInline reads in an extra copy of IR to populate // fn.Inl.{Dcl,Body}. func expandInline(fn *ir.Func, pri pkgReaderIndex) { // TODO(mdempsky): Remove this function. It's currently needed by // dwarfgen/dwarf.go:preInliningDcls, which requires fn.Inl.Dcl to // create abstract function DIEs. But we should be able to provide it // with the same information some other way. fndcls := len(fn.Dcl) topdcls := len(typecheck.Target.Decls) tmpfn := ir.NewFunc(fn.Pos()) tmpfn.Nname = ir.NewNameAt(fn.Nname.Pos(), fn.Sym()) tmpfn.ClosureVars = fn.ClosureVars { r := pri.asReader(pkgbits.RelocBody, pkgbits.SyncFuncBody) setType(tmpfn.Nname, fn.Type()) // Don't change parameter's Sym/Nname fields. r.funarghack = true r.funcBody(tmpfn) ir.WithFunc(tmpfn, func() { deadcode.Func(tmpfn) }) } used := usedLocals(tmpfn.Body) for _, name := range tmpfn.Dcl { if name.Class != ir.PAUTO || used.Has(name) { name.Curfn = fn fn.Inl.Dcl = append(fn.Inl.Dcl, name) } } fn.Inl.Body = tmpfn.Body // Double check that we didn't change fn.Dcl by accident. assert(fndcls == len(fn.Dcl)) // typecheck.Stmts may have added function literals to // typecheck.Target.Decls. Remove them again so we don't risk trying // to compile them multiple times. typecheck.Target.Decls = typecheck.Target.Decls[:topdcls] } // usedLocals returns a set of local variables that are used within body. func usedLocals(body []ir.Node) ir.NameSet { var used ir.NameSet ir.VisitList(body, func(n ir.Node) { if n, ok := n.(*ir.Name); ok && n.Op() == ir.ONAME && n.Class == ir.PAUTO { used.Add(n) } }) return used } // @@@ Method wrappers // needWrapperTypes lists types for which we may need to generate // method wrappers. var needWrapperTypes []*types.Type // haveWrapperTypes lists types for which we know we already have // method wrappers, because we found the type in an imported package. var haveWrapperTypes []*types.Type // needMethodValueWrappers lists methods for which we may need to // generate method value wrappers. var needMethodValueWrappers []methodValueWrapper // haveMethodValueWrappers lists methods for which we know we already // have method value wrappers, because we found it in an imported // package. var haveMethodValueWrappers []methodValueWrapper type methodValueWrapper struct { rcvr *types.Type method *types.Field } func (r *reader) needWrapper(typ *types.Type) { if typ.IsPtr() { return } // If a type was found in an imported package, then we can assume // that package (or one of its transitive dependencies) already // generated method wrappers for it. if r.importedDef() { haveWrapperTypes = append(haveWrapperTypes, typ) } else { needWrapperTypes = append(needWrapperTypes, typ) } } // importedDef reports whether r is reading from an imported and // non-generic element. // // If a type was found in an imported package, then we can assume that // package (or one of its transitive dependencies) already generated // method wrappers for it. // // Exception: If we're instantiating an imported generic type or // function, we might be instantiating it with type arguments not // previously seen before. // // TODO(mdempsky): Distinguish when a generic function or type was // instantiated in an imported package so that we can add types to // haveWrapperTypes instead. func (r *reader) importedDef() bool { return r.p != localPkgReader && !r.hasTypeParams() } func MakeWrappers(target *ir.Package) { // Only unified IR emits its own wrappers. if base.Debug.Unified == 0 { return } // always generate a wrapper for error.Error (#29304) needWrapperTypes = append(needWrapperTypes, types.ErrorType) seen := make(map[string]*types.Type) for _, typ := range haveWrapperTypes { wrapType(typ, target, seen, false) } haveWrapperTypes = nil for _, typ := range needWrapperTypes { wrapType(typ, target, seen, true) } needWrapperTypes = nil for _, wrapper := range haveMethodValueWrappers { wrapMethodValue(wrapper.rcvr, wrapper.method, target, false) } haveMethodValueWrappers = nil for _, wrapper := range needMethodValueWrappers { wrapMethodValue(wrapper.rcvr, wrapper.method, target, true) } needMethodValueWrappers = nil } func wrapType(typ *types.Type, target *ir.Package, seen map[string]*types.Type, needed bool) { key := typ.LinkString() if prev := seen[key]; prev != nil { if !types.Identical(typ, prev) { base.Fatalf("collision: types %v and %v have link string %q", typ, prev, key) } return } seen[key] = typ if !needed { // Only called to add to 'seen'. return } if !typ.IsInterface() { typecheck.CalcMethods(typ) } for _, meth := range typ.AllMethods().Slice() { if meth.Sym.IsBlank() || !meth.IsMethod() { base.FatalfAt(meth.Pos, "invalid method: %v", meth) } methodWrapper(0, typ, meth, target) // For non-interface types, we also want *T wrappers. if !typ.IsInterface() { methodWrapper(1, typ, meth, target) // For not-in-heap types, *T is a scalar, not pointer shaped, // so the interface wrappers use **T. if typ.NotInHeap() { methodWrapper(2, typ, meth, target) } } } } func methodWrapper(derefs int, tbase *types.Type, method *types.Field, target *ir.Package) { wrapper := tbase for i := 0; i < derefs; i++ { wrapper = types.NewPtr(wrapper) } sym := ir.MethodSym(wrapper, method.Sym) base.Assertf(!sym.Siggen(), "already generated wrapper %v", sym) sym.SetSiggen(true) wrappee := method.Type.Recv().Type if types.Identical(wrapper, wrappee) || !types.IsMethodApplicable(wrapper, method) || !reflectdata.NeedEmit(tbase) { return } // TODO(mdempsky): Use method.Pos instead? pos := base.AutogeneratedPos fn := newWrapperFunc(pos, sym, wrapper, method) var recv ir.Node = fn.Nname.Type().Recv().Nname.(*ir.Name) // For simple *T wrappers around T methods, panicwrap produces a // nicer panic message. if wrapper.IsPtr() && types.Identical(wrapper.Elem(), wrappee) { cond := ir.NewBinaryExpr(pos, ir.OEQ, recv, types.BuiltinPkg.Lookup("nil").Def.(ir.Node)) then := []ir.Node{ir.NewCallExpr(pos, ir.OCALL, typecheck.LookupRuntime("panicwrap"), nil)} fn.Body.Append(ir.NewIfStmt(pos, cond, then, nil)) } // typecheck will add one implicit deref, if necessary, // but not-in-heap types require more for their **T wrappers. for i := 1; i < derefs; i++ { recv = Implicit(ir.NewStarExpr(pos, recv)) } addTailCall(pos, fn, recv, method) finishWrapperFunc(fn, target) } func wrapMethodValue(recvType *types.Type, method *types.Field, target *ir.Package, needed bool) { sym := ir.MethodSymSuffix(recvType, method.Sym, "-fm") if sym.Uniq() { return } sym.SetUniq(true) // TODO(mdempsky): Use method.Pos instead? pos := base.AutogeneratedPos fn := newWrapperFunc(pos, sym, nil, method) sym.Def = fn.Nname // Declare and initialize variable holding receiver. recv := ir.NewHiddenParam(pos, fn, typecheck.Lookup(".this"), recvType) if !needed { typecheck.Func(fn) return } addTailCall(pos, fn, recv, method) finishWrapperFunc(fn, target) } func newWrapperFunc(pos src.XPos, sym *types.Sym, wrapper *types.Type, method *types.Field) *ir.Func { fn := ir.NewFunc(pos) fn.SetDupok(true) // TODO(mdempsky): Leave unset for local, non-generic wrappers? name := ir.NewNameAt(pos, sym) ir.MarkFunc(name) name.Func = fn name.Defn = fn fn.Nname = name sig := newWrapperType(wrapper, method) setType(name, sig) // TODO(mdempsky): De-duplicate with similar logic in funcargs. defParams := func(class ir.Class, params *types.Type) { for _, param := range params.FieldSlice() { name := ir.NewNameAt(param.Pos, param.Sym) name.Class = class setType(name, param.Type) name.Curfn = fn fn.Dcl = append(fn.Dcl, name) param.Nname = name } } defParams(ir.PPARAM, sig.Recvs()) defParams(ir.PPARAM, sig.Params()) defParams(ir.PPARAMOUT, sig.Results()) return fn } func finishWrapperFunc(fn *ir.Func, target *ir.Package) { typecheck.Func(fn) ir.WithFunc(fn, func() { typecheck.Stmts(fn.Body) }) // We generate wrappers after the global inlining pass, // so we're responsible for applying inlining ourselves here. inline.InlineCalls(fn) // The body of wrapper function after inlining may reveal new ir.OMETHVALUE node, // we don't know whether wrapper function has been generated for it or not, so // generate one immediately here. ir.VisitList(fn.Body, func(n ir.Node) { if n, ok := n.(*ir.SelectorExpr); ok && n.Op() == ir.OMETHVALUE { wrapMethodValue(n.X.Type(), n.Selection, target, true) } }) target.Decls = append(target.Decls, fn) } // newWrapperType returns a copy of the given signature type, but with // the receiver parameter type substituted with recvType. // If recvType is nil, newWrapperType returns a signature // without a receiver parameter. func newWrapperType(recvType *types.Type, method *types.Field) *types.Type { clone := func(params []*types.Field) []*types.Field { res := make([]*types.Field, len(params)) for i, param := range params { sym := param.Sym if sym == nil || sym.Name == "_" { sym = typecheck.LookupNum(".anon", i) } res[i] = types.NewField(param.Pos, sym, param.Type) res[i].SetIsDDD(param.IsDDD()) } return res } sig := method.Type var recv *types.Field if recvType != nil { recv = types.NewField(sig.Recv().Pos, typecheck.Lookup(".this"), recvType) } params := clone(sig.Params().FieldSlice()) results := clone(sig.Results().FieldSlice()) return types.NewSignature(types.NoPkg, recv, nil, params, results) } func addTailCall(pos src.XPos, fn *ir.Func, recv ir.Node, method *types.Field) { sig := fn.Nname.Type() args := make([]ir.Node, sig.NumParams()) for i, param := range sig.Params().FieldSlice() { args[i] = param.Nname.(*ir.Name) } // TODO(mdempsky): Support creating OTAILCALL, when possible. See reflectdata.methodWrapper. // Not urgent though, because tail calls are currently incompatible with regabi anyway. fn.SetWrapper(true) // TODO(mdempsky): Leave unset for tail calls? dot := ir.NewSelectorExpr(pos, ir.OXDOT, recv, method.Sym) call := typecheck.Call(pos, dot, args, method.Type.IsVariadic()).(*ir.CallExpr) if method.Type.NumResults() == 0 { fn.Body.Append(call) return } ret := ir.NewReturnStmt(pos, nil) ret.Results = []ir.Node{call} fn.Body.Append(ret) } func setBasePos(pos src.XPos) { // Set the position for any error messages we might print (e.g. too large types). base.Pos = pos } // dictParamName is the name of the synthetic dictionary parameter // added to shaped functions. // // N.B., this variable name is known to Delve: // https://github.com/go-delve/delve/blob/cb91509630529e6055be845688fd21eb89ae8714/pkg/proc/eval.go#L28 const dictParamName = ".dict" // shapeSig returns a copy of fn's signature, except adding a // dictionary parameter and promoting the receiver parameter (if any) // to a normal parameter. // // The parameter types.Fields are all copied too, so their Nname // fields can be initialized for use by the shape function. func shapeSig(fn *ir.Func, dict *readerDict) *types.Type { sig := fn.Nname.Type() oldRecv := sig.Recv() var recv *types.Field if oldRecv != nil { recv = types.NewField(oldRecv.Pos, oldRecv.Sym, oldRecv.Type) } params := make([]*types.Field, 1+sig.Params().Fields().Len()) params[0] = types.NewField(fn.Pos(), fn.Sym().Pkg.Lookup(dictParamName), types.NewPtr(dict.varType())) for i, param := range sig.Params().Fields().Slice() { d := types.NewField(param.Pos, param.Sym, param.Type) d.SetIsDDD(param.IsDDD()) params[1+i] = d } results := make([]*types.Field, sig.Results().Fields().Len()) for i, result := range sig.Results().Fields().Slice() { results[i] = types.NewField(result.Pos, result.Sym, result.Type) } return types.NewSignature(types.LocalPkg, recv, nil, params, results) }